Item 19 of 91 (back to results) previous next hydralazine "The 1-hydrazino derivative of phthalazine; a direct-acting vasodilator that is used as an antihypertensive agent."

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > cardiovascular drug [CHEBI:35554] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antihypertensive agent [CHEBI:35674] (104)   hydralazine [CHEBI:5775] (1)  cardiovascular drug [CHEBI:35554] (162)   vasodilator agent [CHEBI:35620] (65)   hydralazine [CHEBI:5775] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   hydrazines [CHEBI:24631] (17)   hydralazine [CHEBI:5775] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  fused compound [CHEBI:35293] (113)   ortho-fused compound [CHEBI:33637] (83)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   hydralazine [CHEBI:5775] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   ortho-fused heteroarene [CHEBI:52362] (16)   hydralazine [CHEBI:5775] (1)  azaarene [CHEBI:50893] (90)   hydralazine [CHEBI:5775] (1) ChEBI Compound Accession Identifier:   [CHEBI:5775] ChEBI Compound Description:   "The 1-hydrazino derivative of phthalazine; a direct-acting vasodilator that is used as an antihypertensive agent." ChEBI Compound Identification Number:   5775 ChEBI InChI Value:   InChI=1S/C8H8N4/c9-11-8-7-4-2-1-3-6(7)5-10-12-8/h1-5H,9H2,(H,11,12) ChEBI InChIKey Value:   RPTUSVTUFVMDQK-UHFFFAOYSA-N ChEBI Compound Name:   hydralazine ChEBI SMILES Value:   NNc1nncc2ccccc12 ChEBI Substance ID:   99437371 ChEBI URL:   ChEBI:5775 ChemSpider ID:   3511 Ontomatica Chemical Accession Key (OnChAKey):   RPTUSVTUFVMDQK_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3637