New Search

Item 19 of 86 (back to results)
Previous previous next Next

cathestatin B
A carboxamide obtained by the formal condensation of the carboxylic group of oxirane-2,3-dicarboxylic acid with the amino group of N-(4-aminobutyl)-L-tyrosinamide (the 2S,3S stereoisomer). An antibiotic isolated from the fermentation broth of Penicillium citrinum, it acts as a potent inhibitor of cysteine protease.


Current search:

07. Part of Biological Source of Chemical: unspecified structure [PO:0000004]
×
03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 protease inhibitor [CHEBI:37670] (37) 
 cysteine protease inhibitor [CHEBI:64152] (11) 
 cathestatin B [CHEBI:65600] (1)
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 cathestatin B [CHEBI:65600] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antibiotic [CHEBI:22582] (193) 
 cathestatin B [CHEBI:65600] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Fungi, Yeasts, Molds and Mildews (348) 
 Deuteromycotina (255) 
 Ochroconis (97) 
 Penicillium (97) 
 Penicillium citrinum (8)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 cathestatin B [CHEBI:65600] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 cathestatin B [CHEBI:65600] (1)
 organic amino compound [CHEBI:50047] (2472) 
 primary amino compound [CHEBI:50994] (104) 
 cathestatin B [CHEBI:65600] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 carboxamide [CHEBI:37622] (1381) 
 cathestatin B [CHEBI:65600] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 carboxamide [CHEBI:37622] (1381) 
 cathestatin B [CHEBI:65600] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 cathestatin B [CHEBI:65600] (1)
 organic amino compound [CHEBI:50047] (2472) 
 primary amino compound [CHEBI:50994] (104) 
 cathestatin B [CHEBI:65600] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 carboxamide [CHEBI:37622] (1381) 
 cathestatin B [CHEBI:65600] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
 organic amino compound [CHEBI:50047] (2472) 
 primary amino compound [CHEBI:50994] (104) 
 cathestatin B [CHEBI:65600] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 epoxide [CHEBI:32955] (145) 
 cathestatin B [CHEBI:65600] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cathestatin B [CHEBI:65600] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 cathestatin B [CHEBI:65600] (1)
ChEBI Compound Accession Identifier  [CHEBI:65600]
ChEBI Compound Description  A carboxamide obtained by the formal condensation of the carboxylic group of oxirane-2,3-dicarboxylic acid with the amino group of N-(4-aminobutyl)-L-tyrosinamide (the 2S,3S stereoisomer). An antibiotic isolated from the fermentation broth of Penicillium citrinum, it acts as a potent inhibitor of cysteine protease.
ChEBI Compound Identification Number  65600
ChEBI InChI Value  InChI=1S/C17H23N3O6/c18-7-1-2-8-19-15(22)12(9-10-3-5-11(21)6-4-10)20-16(23)13-14(26-13)17(24)25/h3-6,12-14,21H,1-2,7-9,18H2,(H,19,22)(H,20,23)(H,24,25)/t12-,13-,14-/m0/s1
ChEBI InChIKey Value  JAJMETBQBCMJSZ-IHRRRGAJSA-N
ChEBI Compound Name  cathestatin B
ChEBI SMILES Value  NCCCCNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H]1O[C@@H]1C(O)=O
ChEBI Substance ID  160655801
ChEBI URL  ChEBI:65600
ChemSpider ID  10223767
Ontomatica Chemical Accession Key (OnChAKey)  JAJMETBQBCMJSZ_IHRRRGAJSA_N_000_000000
PubChem Compound ID  21597398