Item 190 of 214 (back to results) previous next (-)-marinopyrrole B A member of the class of pyrroles that is 1'H-1,3'-bipyrrole substituted by a bromo group at position 3, four chloro groups at positions 4, 4', 5 and 5' and two 2-hydroxybenzoyl moieties at positions 2 and 2'. It is isolated from Streptomyces sp.CNQ-418 and exhibits cytotoxic and antibacterial activities.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > carbon group molecular entity [CHEBI:33582] > organic molecular entity [CHEBI:50860] > organic molecule [CHEBI:72695] > organic oxo compound [CHEBI:36587] > carbonyl compound [CHEBI:36586] × 07. Part of Biological Source of Chemical: unspecified structure [PO:0000004] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   (-)-marinopyrrole B [CHEBI:66679] (1)  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   (-)-marinopyrrole B [CHEBI:66679] (1)  antibacterial agent [CHEBI:33282] (317)   (-)-marinopyrrole B [CHEBI:66679] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Streptomycetaceae (160)   Streptomyces (157) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   (-)-marinopyrrole B [CHEBI:66679] (1)  chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   (-)-marinopyrrole B [CHEBI:66679] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   (-)-marinopyrrole B [CHEBI:66679] (1)  organobromine compound [CHEBI:37141] (138)   (-)-marinopyrrole B [CHEBI:66679] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   (-)-marinopyrrole B [CHEBI:66679] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   (-)-marinopyrrole B [CHEBI:66679] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   (-)-marinopyrrole B [CHEBI:66679] (1)  organobromine compound [CHEBI:37141] (138)   (-)-marinopyrrole B [CHEBI:66679] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   (-)-marinopyrrole B [CHEBI:66679] (1)  mancude ring [CHEBI:35568] (488)   organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   (-)-marinopyrrole B [CHEBI:66679] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   (-)-marinopyrrole B [CHEBI:66679] (1)  hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   (-)-marinopyrrole B [CHEBI:66679] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   (-)-marinopyrrole B [CHEBI:66679] (1)  organobromine compound [CHEBI:37141] (138)   (-)-marinopyrrole B [CHEBI:66679] (1) ChEBI Compound Accession Identifier:   [CHEBI:66679] ChEBI Compound Description:   A member of the class of pyrroles that is 1'H-1,3'-bipyrrole substituted by a bromo group at position 3, four chloro groups at positions 4, 4', 5 and 5' and two 2-hydroxybenzoyl moieties at positions 2 and 2'. It is isolated from Streptomyces sp.CNQ-418 and exhibits cytotoxic and antibacterial activities. ChEBI Compound Identification Number:   66679 ChEBI InChI Value:   InChI=1S/C22H11BrCl4N2O4/c23-13-14(24)22(27)29(17(13)20(33)10-6-2-4-8-12(10)31)18-15(25)21(26)28-16(18)19(32)9-5-1-3-7-11(9)30/h1-8,28,30-31H ChEBI InChIKey Value:   XAANSONIBUCODQ-UHFFFAOYSA-N ChEBI Compound Name:   (-)-marinopyrrole B ChEBI SMILES Value:   Oc1ccccc1C(=O)c1[nH]c(Cl)c(Cl)c1-n1c(Cl)c(Cl)c(Br)c1C(=O)c1ccccc1O ChEBI Substance ID:   160645561 ChEBI URL:   ChEBI:66679 ChemSpider ID:   27023263 Ontomatica Chemical Accession Key (OnChAKey):   XAANSONIBUCODQ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   24797084