Item 20 of 148 (back to results) previous next flavoxate A carboxylic ester resulting from the formal condensation of 3-methylflavone-8-carboxylic acid with 2-(1-piperidinyl)ethanol.

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] > monocyclic compound [CHEBI:33661] > heteromonocyclic compound [CHEBI:33670] × 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   cholinergic drug [CHEBI:38323] (108)   cholinergic antagonist [CHEBI:48873] (84)   muscarinic antagonist [CHEBI:48876] (61)   flavoxate [CHEBI:5088] (1)  parasympatholytic [CHEBI:50370] (17)   flavoxate [CHEBI:5088] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   neuromuscular agent [CHEBI:51372] (51)   muscle relaxant [CHEBI:51371] (47)   antispasmodic drug [CHEBI:53784] (18)   flavoxate [CHEBI:5088] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   flavoxate [CHEBI:5088] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   flavoxate [CHEBI:5088] (1)  flavonoids [CHEBI:72544] (433)   flavonoid [CHEBI:47916] (301)   flavones [CHEBI:24043] (130)   flavoxate [CHEBI:5088] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   flavoxate [CHEBI:5088] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   flavoxate [CHEBI:5088] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   flavoxate [CHEBI:5088] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   flavoxate [CHEBI:5088] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   flavoxate [CHEBI:5088] (1)  flavonoids [CHEBI:72544] (433)   flavonoid [CHEBI:47916] (301)   flavones [CHEBI:24043] (130)   flavoxate [CHEBI:5088] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   flavoxate [CHEBI:5088] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   flavoxate [CHEBI:5088] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   flavoxate [CHEBI:5088] (1) ChEBI Compound Accession Identifier:   [CHEBI:5088] ChEBI Compound Description:   A carboxylic ester resulting from the formal condensation of 3-methylflavone-8-carboxylic acid with 2-(1-piperidinyl)ethanol. ChEBI Compound Identification Number:   5088 ChEBI InChI Value:   InChI=1S/C24H25NO4/c1-17-21(26)19-11-8-12-20(23(19)29-22(17)18-9-4-2-5-10-18)24(27)28-16-15-25-13-6-3-7-14-25/h2,4-5,8-12H,3,6-7,13-16H2,1H3 ChEBI InChIKey Value:   SPIUTQOUKAMGCX-UHFFFAOYSA-N ChEBI Compound Name:   flavoxate ChEBI SMILES Value:   Cc1c(oc2c(cccc2c1=O)C(=O)OCCN1CCCCC1)-c1ccccc1 ChEBI Substance ID:   111978146 ChEBI URL:   ChEBI:5088 ChemSpider ID:   3237 Ontomatica Chemical Accession Key (OnChAKey):   SPIUTQOUKAMGCX_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3354