New Search

Item 197 of 347 (back to results)
Previous previous next Next

fukanemarin B
A hydroxycoumarin that is 4-hydroxycoumarin substituted by a methoxy group ar position 7 and a 1,2,6-trimethyl-7-(4-methyl-2-furyl)-hepta-2(E),5(E)-dienyl moiety at position 3. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO).


Current search:

06. Name of Biological Source of Chemical: Plantae
×
07. Part of Biological Source of Chemical: plant structure [PO:0009011]
×
03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 nitric oxide synthase inhibitor [CHEBI:61908] (36) 
 fukanemarin B [CHEBI:65920] (1)
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 fukanemarin B [CHEBI:65920] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Apiales (90) 
 Apiaceae (42) 
 Ferula (25) 
 Ferula fukanensis (12)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 multi-tissue plant structure [PO:0025496] (1114) 
 plant organ [PO:0009008] (970) 
 plant axis [PO:0025004] (691) 
 root [PO:0009005] (486)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 sesquiterpenoid [CHEBI:26658] (209) 
 fukanemarin B [CHEBI:65920] (1)
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 sesquiterpenoid [CHEBI:26658] (209) 
 fukanemarin B [CHEBI:65920] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 aromatic ether [CHEBI:35618] (353) 
 fukanemarin B [CHEBI:65920] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 aromatic ether [CHEBI:35618] (353) 
 fukanemarin B [CHEBI:65920] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 aromatic ether [CHEBI:35618] (353) 
 fukanemarin B [CHEBI:65920] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 furans [CHEBI:24129] (114) 
 fukanemarin B [CHEBI:65920] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 1-benzopyran [CHEBI:38443] (328) 
 chromenes [CHEBI:23232] (118) 
 chromenone [CHEBI:38445] (61) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 coumarins [CHEBI:23403] (50) 
 hydroxycoumarin [CHEBI:37912] (26) 
 fukanemarin B [CHEBI:65920] (1)
 aromatic ether [CHEBI:35618] (353) 
 fukanemarin B [CHEBI:65920] (1)
ChEBI Compound Accession Identifier  [CHEBI:65920]
ChEBI Compound Description  A hydroxycoumarin that is 4-hydroxycoumarin substituted by a methoxy group ar position 7 and a 1,2,6-trimethyl-7-(4-methyl-2-furyl)-hepta-2(E),5(E)-dienyl moiety at position 3. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO).
ChEBI Compound Identification Number  65920
ChEBI InChI Value  InChI=1S/C25H28O5/c1-15(11-20-12-16(2)14-29-20)7-6-8-17(3)18(4)23-24(26)21-10-9-19(28-5)13-22(21)30-25(23)27/h7-10,12-14,18,26H,6,11H2,1-5H3/b15-7+,17-8+
ChEBI InChIKey Value  BPQMZQHENRZFOK-GXZANXLRSA-N
ChEBI Compound Name  fukanemarin B
ChEBI SMILES Value  COc1ccc2c(O)c(C(C)C(\C)=C\C\C=C(/C)Cc3cc(C)co3)c(=O)oc2c1
ChEBI Substance ID  160709490
ChEBI URL  ChEBI:65920
ChemSpider ID  28282188
Ontomatica Chemical Accession Key (OnChAKey)  BPQMZQHENRZFOK_GXZANXLRSA_N_000_000000
PubChem Compound ID  54717251