| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
|
|
|
|
|
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
presqualene diphosphate(3-) [CHEBI:57310] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:57310] |
| ChEBI Compound Description: |
A triply-charged organophosphate oxoanion obtained by deprotonation of the phosphate OH groups of presqualene diphosphate. |
| ChEBI Compound Identification Number: |
57310 |
| ChEBI InChI Value: |
InChI=1S/C30H52O7P2/c1-23(2)13-9-15-25(5)17-11-18-27(7)21-28-29(22-36-39(34,35)37-38(31,32)33)30(28,8)20-12-19-26(6)16-10-14-24(3)4/h13-14,17,19,21,28-29H,9-12,15-16,18,20,22H2,1-8H3,(H,34,35)(H2,31,32,33)/p-3/b25-17+,26-19+,27-21+/t28-,29-,30-/m0/s1 |
| ChEBI InChIKey Value: |
ATZKAUGGNMSCCY-VYCBRMPGSA-K |
| ChEBI Compound Name: |
presqualene diphosphate(3-) |
| ChEBI SMILES Value: |
CC(C)=CCC\C(C)=C\CC\C(C)=C\[C@H]1[C@H](COP([O-])(=O)OP([O-])([O-])=O)[C@@]1(C)CC\C=C(/C)CCC=C(C)C |
| ChEBI Substance ID: |
135610314 |
| ChEBI URL: |
ChEBI:57310 |
| ChemSpider ID: |
27471281 |
| Ontomatica Chemical Accession Key (OnChAKey): |
ATZKAUGGNMSCCY_VYCBRMPGSA_K_000_000000 |
| PubChem Compound ID: |
25244634 |