| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
4'''-demalonylsalvianin(1-) [CHEBI:58638] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:58638] |
| ChEBI Compound Description: |
Conjugate base of 4'''-demalonylsalvianin. |
| ChEBI Compound Identification Number: |
58638 |
| ChEBI InChI Value: |
InChI=1S/C39H38O21/c40-18-5-3-17(4-6-18)37-25(58-39-36(53)34(51)31(48)26(60-39)14-54-29(46)8-2-16-1-7-21(42)22(43)9-16)12-20-23(56-37)10-19(41)11-24(20)57-38-35(52)33(50)32(49)27(59-38)15-55-30(47)13-28(44)45/h1-12,26-27,31-36,38-39,48-53H,13-15H2,(H4-,40,41,42,43,44,45,46)/p-1/t26-,27-,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1 |
| ChEBI InChIKey Value: |
HWGACSBPJIKSNP-KMKFZPLVSA-M |
| ChEBI Compound Name: |
4'''-demalonylsalvianin(1-) |
| ChEBI SMILES Value: |
O[C@@H]1[C@@H](COC(=O)CC([O-])=O)O[C@@H](Oc2cc([O-])cc3[o+]c(-c4ccc(O)cc4)c(O[C@@H]4O[C@H](COC(=O)\C=C\c5ccc(O)c(O)c5)[C@@H](O)[C@H](O)[C@H]4O)cc23)[C@H](O)[C@H]1O |
| ChEBI Substance ID: |
92741534 |
| ChEBI URL: |
ChEBI:58638 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
HWGACSBPJIKSNP_KMKFZPLVSA_M_000_000000 |
| PubChem Compound ID: |
45266706 |