Item 3 of 3 (back to results) previous geranic acid A polyunsaturated fatty acid that is octa-2,6-dienoic acid bearing two methyl substituents at positions 3 and 7 (the 2E-isomer).

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > s-block molecular entity [CHEBI:33674] > hydrogen molecular entity [CHEBI:33608] > hydroxides [CHEBI:24651] > oxoacid [CHEBI:24833] > carbon oxoacid [CHEBI:35605] > carboxylic acid [CHEBI:33575] > monocarboxylic acid [CHEBI:25384] > fatty acid [CHEBI:35366] > unsaturated fatty acid [CHEBI:27208] × 03. Biological Effects of Specific Chemicals: molecular messenger [CHEBI:33280] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   tyrosinase inhibitor [CHEBI:59997] (9)   geranic acid [CHEBI:67264] (1)  molecular messenger [CHEBI:33280] (92)   semiochemical [CHEBI:26645] (10)   pheromone [CHEBI:26013] (8)   geranic acid [CHEBI:67264] (1)  antimicrobial agent [CHEBI:33281] (927)   fungicide [CHEBI:24127] (52)   geranic acid [CHEBI:67264] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   monoterpenoid [CHEBI:25409] (157)   geranic acid [CHEBI:67264] (1)  fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   monoterpenoid [CHEBI:25409] (157)   geranic acid [CHEBI:67264] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   fatty acid [CHEBI:35366] (487)   unsaturated fatty acid [CHEBI:27208] (309)   polyunsaturated fatty acid [CHEBI:26208] (184)   geranic acid [CHEBI:67264] (1)  branched-chain fatty acid [CHEBI:35819] (63)   methyl-branched fatty acid [CHEBI:62499] (24)   geranic acid [CHEBI:67264] (1) ChEBI Compound Accession Identifier:   [CHEBI:67264] ChEBI Compound Description:   A polyunsaturated fatty acid that is octa-2,6-dienoic acid bearing two methyl substituents at positions 3 and 7 (the 2E-isomer). ChEBI Compound Identification Number:   67264 ChEBI InChI Value:   InChI=1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12)/b9-7+ ChEBI InChIKey Value:   ZHYZQXUYZJNEHD-VQHVLOKHSA-N ChEBI Compound Name:   geranic acid ChEBI SMILES Value:   CC(C)=CCC\C(C)=C\C(O)=O ChEBI Substance ID:   160645480 ChEBI URL:   ChEBI:67264 ChemSpider ID:   4439624 Ontomatica Chemical Accession Key (OnChAKey):   ZHYZQXUYZJNEHD_VQHVLOKHSA_N_000_000000 PubChem Compound ID:   5275520