| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Egg (37) | 
 | 
| 
 | 
 Milk (61) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Oyster (1) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (41) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Poultry, fat (34) | 
 | 
| 
 | 
 Poultry, meat (32) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Asparagus (23) | 
 | 
| 
 | 
 Banana (25) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 Pineapple (16) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1B : Root vegetables (except sugar beet) subgroup (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 02 : Leaves of Root & Tuber Vegetables (Human Food or Animal Feed) Group (10) | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Spinach (9) | 
 | 
| 
 | 
 Endive (6) | 
 | 
| 
 | 
 Lettuce (6) | 
 | 
| 
 | 
 Spinach (9) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 04 Subgroup 4B : Leaf petioles subgroup (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Broccoli, Chinese (3) | 
 | 
| 
 | 
 Brussels sprouts (12) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Cabbage, Chinese (napa) (3) | 
 | 
| 
 | 
 Cabbage, Chinese mustard (3) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 Cavalo broccolo (3) | 
 | 
| 
 | 
 Kohlrabi (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 Broccoli raab (2) | 
 | 
| 
 | 
 Cabbage, Chinese (bok choy) (2) | 
 | 
| 
 | 
 Collards (8) | 
 | 
| 
 | 
 Kale (7) | 
 | 
| 
 | 
 Mizuna (2) | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 Mustard spinach (2) | 
 | 
| 
 | 
 Rape greens (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6A : Edible-podded legume vegetables subgroup (8) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6C : Dried shelled pea & bean (except soybean) subgroup (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 07 Subgroup 7A : Foliage of legume vegetables (except soybeans) subgroup (4) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07A : Caneberry subgroup (12) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07B : Bushberry subgroup (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Brazil nut (1) | 
 | 
| 
 | 
 Butternut (2) | 
 | 
| 
 | 
 Cashew (1) | 
 | 
| 
 | 
 Chestnut (3) | 
 | 
| 
 | 
 Chinquapin (1) | 
 | 
| 
 | 
 Hickory nut (1) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 African nut-tree (1) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Beechnut (1) | 
 | 
| 
 | 
 Brazil nut (1) | 
 | 
| 
 | 
 Brazilian pine (1) | 
 | 
| 
 | 
 Bunya (1) | 
 | 
| 
 | 
 Bur oak (1) | 
 | 
| 
 | 
 Butternut (2) | 
 | 
| 
 | 
 Cajou nut (1) | 
 | 
| 
 | 
 Candlenut (1) | 
 | 
| 
 | 
 Cashew (1) | 
 | 
| 
 | 
 Chestnut (3) | 
 | 
| 
 | 
 Chinquapin (1) | 
 | 
| 
 | 
 Coconut (3) | 
 | 
| 
 | 
 Coquito nut (1) | 
 | 
| 
 | 
 Dika nut (1) | 
 | 
| 
 | 
 Ginkgo (1) | 
 | 
| 
 | 
 Guiana chestnut (1) | 
 | 
| 
 | 
 Hazelnut (Filbert) (1) | 
 | 
| 
 | 
 Heartnut (1) | 
 | 
| 
 | 
 Hickory nut (1) | 
 | 
| 
 | 
 Japanese horse-chestnut (1) | 
 | 
| 
 | 
 Macadamia nut (1) | 
 | 
| 
 | 
 Mongongo nut (1) | 
 | 
| 
 | 
 Monkey-pot (1) | 
 | 
| 
 | 
 Monkey puzzle nut (1) | 
 | 
| 
 | 
 Okari nut (1) | 
 | 
| 
 | 
 Pachira nut (1) | 
 | 
| 
 | 
 Peach palm nut (1) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Pequi (1) | 
 | 
| 
 | 
 Pili nut (1) | 
 | 
| 
 | 
 Pine nut (1) | 
 | 
| 
 | 
 Pistachio (28) | 
 | 
| 
 | 
 Sapucaia nut (1) | 
 | 
| 
 | 
 Tropical almond (1) | 
 | 
| 
 | 
 Yellowhorn (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Rice, grain (19) | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 Millet, proso, grain (1) | 
 | 
| 
 | 
 Rice, grain (19) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Clover, forage (7) | 
 | 
| 
 | 
 Soybean, forage (17) | 
 | 
| 
 | 
 Trefoil, forage (3) | 
 | 
| 
 | 
 Clover, hay (7) | 
 | 
| 
 | 
 Peanut, hay (19) | 
 | 
| 
 | 
 Soybean, hay (17) | 
 | 
| 
 | 
 Trefoil, hay (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Alfalfa (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Clover, forage (7) | 
 | 
| 
 | 
 Trefoil, forage (3) | 
 | 
| 
 | 
 Clover, hay (7) | 
 | 
| 
 | 
 Trefoil, hay (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Dillweed (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sunflower, seed (16) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 carbaryl [CHEBI:3390] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:3390] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 3390 | 
| ChEBI InChI Value:  | 
 InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) | 
| ChEBI InChIKey Value:  | 
 CVXBEEMKQHEXEN-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 carbaryl | 
| ChEBI SMILES Value:  | 
 CNC(=O)Oc1cccc2ccccc12 | 
| ChEBI Substance ID:  | 
 24775873 | 
| ChEBI URL:  | 
 ChEBI:3390 | 
| ChemSpider ID:  | 
 5899 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 CVXBEEMKQHEXEN_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 6129 |