New Search

Item 2014 of 2225 (back to results)
Previous previous next Next

maprounic acid
A pentacyclic triterpenoid isolated from Maprounea africana and has been shown to exhibit inhibitory activity against HIV-1 reverse transcriptase.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 maprounic acid [CHEBI:73107] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antiviral agent [CHEBI:22587] (216) 
 anti-HIV agent [CHEBI:64946] (126) 
 anti-HIV-1 agent [CHEBI:64947] (79) 
 HIV-1 reverse transcriptase inhibitor [CHEBI:53756] (30) 
 maprounic acid [CHEBI:73107] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 triterpenoid [CHEBI:36615] (228) 
 pentacyclic triterpenoid [CHEBI:25872] (112) 
 maprounic acid [CHEBI:73107] (1)
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 triterpenoid [CHEBI:36615] (228) 
 pentacyclic triterpenoid [CHEBI:25872] (112) 
 maprounic acid [CHEBI:73107] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 pentacyclic triterpenoid [CHEBI:25872] (112) 
 maprounic acid [CHEBI:73107] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 pentacyclic triterpenoid [CHEBI:25872] (112) 
 maprounic acid [CHEBI:73107] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 pentacyclic triterpenoid [CHEBI:25872] (112) 
 maprounic acid [CHEBI:73107] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 pentacyclic triterpenoid [CHEBI:25872] (112) 
 maprounic acid [CHEBI:73107] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 maprounic acid [CHEBI:73107] (1)
ChEBI Compound Accession Identifier  [CHEBI:73107]
ChEBI Compound Description  A pentacyclic triterpenoid isolated from Maprounea africana and has been shown to exhibit inhibitory activity against HIV-1 reverse transcriptase.
ChEBI Compound Identification Number  73107
ChEBI InChI Value  InChI=1S/C30H48O3/c1-25(2)16-17-30(24(32)33)15-10-21-28(6)12-8-19-26(3,4)23(31)11-14-27(19,5)20(28)9-13-29(21,7)22(30)18-25/h10,19-20,22-23,31H,8-9,11-18H2,1-7H3,(H,32,33)/t19-,20+,22-,23-,27-,28+,29+,30+/m0/s1
ChEBI InChIKey Value  BHHPRAFMEFGOLZ-QVUWEPBXSA-N
ChEBI Compound Name  maprounic acid
ChEBI SMILES Value  [H][C@@]12CC[C@@]3(C)C4=CC[C@]5(CCC(C)(C)C[C@@]5([H])[C@]4(C)CC[C@]3([H])[C@@]1(C)CC[C@H](O)C2(C)C)C(O)=O
ChEBI Substance ID  162169199
ChEBI URL  ChEBI:73107
ChemSpider ID  141879
Ontomatica Chemical Accession Key (OnChAKey)  BHHPRAFMEFGOLZ_QVUWEPBXSA_N_000_000000
PubChem Compound ID  161527