New Search

Item 22 of 106 (back to results)
Previous previous next Next

2-naphthol
null


Current search:

08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367]
×
05. Industrial Uses: pesticide [CHEBI:25944]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pesticide [CHEBI:25944] (211) 
 nematicide [CHEBI:25491] (24) 
 antinematodal drug [CHEBI:35444] (11) 
 2-naphthol [CHEBI:10432] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthols [CHEBI:25392] (9) 
 naphthol [CHEBI:35682] (2) 
 2-naphthol [CHEBI:10432] (1)
ChEBI Compound Accession Identifier  [CHEBI:10432]
ChEBI Compound Description  null
ChEBI Compound Identification Number  10432
ChEBI InChI Value  InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H
ChEBI InChIKey Value  JWAZRIHNYRIHIV-UHFFFAOYSA-N
ChEBI Compound Name  2-naphthol
ChEBI SMILES Value  Oc1ccc2ccccc2c1
ChEBI Substance ID  8148191
ChEBI URL  ChEBI:10432
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  JWAZRIHNYRIHIV_UHFFFAOYSA_N_000_000000
PubChem Compound ID  8663