Item 23 of 2877 (back to results) previous next paxanthonin A member of the class of xanthones that is 9H-xanthen-9-one substituted by a 2,2-dimethyl-4-(prop-1-en-2-yl)cyclopentyl group at position 2, hydroxy groups at positions 1, 3 and 6 and a methoxy group at position 5. It is isolated from the callus of Hypericum perforatum and exhibits antioxidant and antimicrobial activities.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   paxanthonin [CHEBI:71520] (1)  antimicrobial agent [CHEBI:33281] (927)   paxanthonin [CHEBI:71520] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   paxanthonin [CHEBI:71520] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   paxanthonin [CHEBI:71520] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   paxanthonin [CHEBI:71520] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1)  aromatic ether [CHEBI:35618] (353)   paxanthonin [CHEBI:71520] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1)  aromatic ether [CHEBI:35618] (353)   paxanthonin [CHEBI:71520] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1)  aromatic ether [CHEBI:35618] (353)   paxanthonin [CHEBI:71520] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1)  aromatic ether [CHEBI:35618] (353)   paxanthonin [CHEBI:71520] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   paxanthonin [CHEBI:71520] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   paxanthonin [CHEBI:71520] (1) 09. Chemical Capabilities  09. Chemical Capabilities  antioxidant [CHEBI:22586] (199)   radical scavenger [CHEBI:48578] (62)   paxanthonin [CHEBI:71520] (1) ChEBI Compound Accession Identifier:   [CHEBI:71520] ChEBI Compound Description:   A member of the class of xanthones that is 9H-xanthen-9-one substituted by a 2,2-dimethyl-4-(prop-1-en-2-yl)cyclopentyl group at position 2, hydroxy groups at positions 1, 3 and 6 and a methoxy group at position 5. It is isolated from the callus of Hypericum perforatum and exhibits antioxidant and antimicrobial activities. ChEBI Compound Identification Number:   71520 ChEBI InChI Value:   InChI=1S/C24H26O6/c1-11(2)12-8-14(24(3,4)10-12)18-16(26)9-17-19(21(18)28)20(27)13-6-7-15(25)23(29-5)22(13)30-17/h6-7,9,12,14,25-26,28H,1,8,10H2,2-5H3/t12-,14+/m0/s1 ChEBI InChIKey Value:   GYBUSKWANOPNPI-GXTWGEPZSA-N ChEBI Compound Name:   paxanthonin ChEBI SMILES Value:   [H][C@@]1(C[C@]([H])(c2c(O)cc3oc4c(OC)c(O)ccc4c(=O)c3c2O)C(C)(C)C1)C(C)=C ChEBI Substance ID:   160713604 ChEBI URL:   ChEBI:71520 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   GYBUSKWANOPNPI_GXTWGEPZSA_N_000_000000 PubChem Compound ID:   70698384