Item 23 of 23 (back to results) previous pacific blue succinimidyl ester An N-hydroxysuccinimide ester derived from 6,8-difluoro-7-hydroxycoumarin-3-carboxylic acid (pacific blue). A fluorescent dye of excitation wavelength 403 nm and emission wavelength 455 nm.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > carbon group molecular entity [CHEBI:33582] > organic molecular entity [CHEBI:50860] > organic molecule [CHEBI:72695] > organic oxo compound [CHEBI:36587] > carbonyl compound [CHEBI:36586] × 05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  dye [CHEBI:37958] (446)   fluorescent dye [CHEBI:51121] (410)   fluorochrome [CHEBI:51217] (404)   pacific blue succinimidyl ester [CHEBI:63240] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   pacific blue succinimidyl ester [CHEBI:63240] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   pacific blue succinimidyl ester [CHEBI:63240] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   N-hydroxysuccinimide ester [CHEBI:53165] (4)   pacific blue succinimidyl ester [CHEBI:63240] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   N-hydroxysuccinimide ester [CHEBI:53165] (4)   pacific blue succinimidyl ester [CHEBI:63240] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   N-hydroxysuccinimide ester [CHEBI:53165] (4)   pacific blue succinimidyl ester [CHEBI:63240] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   N-hydroxysuccinimide ester [CHEBI:53165] (4)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   N-hydroxysuccinimide ester [CHEBI:53165] (4)   pacific blue succinimidyl ester [CHEBI:63240] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue succinimidyl ester [CHEBI:63240] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   N-hydroxysuccinimide ester [CHEBI:53165] (4)   pacific blue succinimidyl ester [CHEBI:63240] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   pacific blue succinimidyl ester [CHEBI:63240] (1) ChEBI Compound Accession Identifier:   [CHEBI:63240] ChEBI Compound Description:   An N-hydroxysuccinimide ester derived from 6,8-difluoro-7-hydroxycoumarin-3-carboxylic acid (pacific blue). A fluorescent dye of excitation wavelength 403 nm and emission wavelength 455 nm. ChEBI Compound Identification Number:   63240 ChEBI InChI Value:   InChI=1S/C14H7F2NO7/c15-7-4-5-3-6(13(21)23-12(5)10(16)11(7)20)14(22)24-17-8(18)1-2-9(17)19/h3-4,20H,1-2H2 ChEBI InChIKey Value:   NZYXABPVYJRICY-UHFFFAOYSA-N ChEBI Compound Name:   pacific blue succinimidyl ester ChEBI SMILES Value:   Oc1c(F)cc2cc(C(=O)ON3C(=O)CCC3=O)c(=O)oc2c1F ChEBI Substance ID:   135610452 ChEBI URL:   ChEBI:63240 ChemSpider ID:   26333046 Ontomatica Chemical Accession Key (OnChAKey):   NZYXABPVYJRICY_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   56927770