more general categories
information about this item
03. Biological Effects of Specific Chemicals
03. Biological Effects of Specific Chemicals
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
05. Industrial Uses
05. Industrial Uses
macluraxanthone B [CHEBI:66649] (1)
06. Name of Biological Source of Chemical
06. Name of Biological Source of Chemical
Maclura tinctoria (3)
07. Part of Biological Source of Chemical
07. Part of Biological Source of Chemical
unspecified structure [PO:0000004] (703)
08. Chemical Category
08. Chemical Category
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
macluraxanthone B [CHEBI:66649] (1)
ChEBI Compound Accession Identifier :
[CHEBI:66649]
ChEBI Compound Description :
A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 3, 6 and 7, a dimethylallyl group at position 2 and a prenyl group at position 4. Isolated from Maclura tinctoria and Cudrania tricuspidata, it exhibits anti-HIV and antineoplastic activity.
ChEBI Compound Identification Number :
66649
ChEBI InChI Value :
InChI=1S/C23H24O6/c1-6-23(4,5)18-20(27)12(8-7-11(2)3)22-17(21(18)28)19(26)13-9-14(24)15(25)10-16(13)29-22/h6-7,9-10,24-25,27-28H,1,8H2,2-5H3
ChEBI InChIKey Value :
QFYDCUMYVXSZFJ-UHFFFAOYSA-N
ChEBI Compound Name :
macluraxanthone B
ChEBI SMILES Value :
CC(C)=CCc1c(O)c(c(O)c2c1oc1cc(O)c(O)cc1c2=O)C(C)(C)C=C
ChEBI Substance ID :
160710510
ChEBI URL :
ChEBI:66649
ChemSpider ID :
4510200
Ontomatica Chemical Accession Key (OnChAKey) :
QFYDCUMYVXSZFJ_UHFFFAOYSA_N_000_000000
PubChem Compound ID :
5353737