New Search

Item 26 of 120 (back to results)
Previous previous next Next

1-O-sinapoyl-beta-D-glucose
null


Current search:

04. Bioactive Capabilities of Specific Chemicals : Transferases [EC:2]
×
08. Chemical Category: main group molecular entity [CHEBI:33579] > s-block molecular entity [CHEBI:33674] > hydrogen molecular entity [CHEBI:33608]
×

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Transferases [EC:2] (1441) 
 Acyltransferases [EC:2.3] (299) 
 Transferring groups other than amino-acyl groups [EC:2.3.1] (266) 
 Sinapoylglucose--choline O-sinapoyltransferase [EC:2.3.1.91] (4) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 Sinapoylglucose--malate O-sinapoyltransferase [EC:2.3.1.92] (4) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 Sinapoylglucose--sinapoylglucose O-sinapoyltransferase [EC:2.3.1.103] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 Glycosyltransferases [EC:2.4] (334) 
 Hexosyltransferases [EC:2.4.1] (257) 
 Cyanidin 3-O-glucoside 5-O-glucosyltransferase (acyl-glucose) [EC:2.4.1.299] (5) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 cinnamic acids [CHEBI:23252] (30) 
 hydroxycinnamic acid [CHEBI:24689] (23) 
 monohydroxycinnamic acid [CHEBI:24688] (16) 
 glucosyl hydroxycinnamic acid [CHEBI:24282] (3) 
 1-O-sinapoyl-beta-D-glucose [CHEBI:16546] (1)
ChEBI Compound Accession Identifier  [CHEBI:16546]
ChEBI Compound Description  null
ChEBI Compound Identification Number  16546
ChEBI InChI Value  InChI=1S/C17H22O10/c1-24-9-5-8(6-10(25-2)13(9)20)3-4-12(19)27-17-16(23)15(22)14(21)11(7-18)26-17/h3-6,11,14-18,20-23H,7H2,1-2H3/b4-3+/t11-,14-,15+,16-,17+/m1/s1
ChEBI InChIKey Value  XRKBRPFTFKKHEF-DGDBGZAXSA-N
ChEBI Compound Name  1-O-sinapoyl-beta-D-glucose
ChEBI SMILES Value  COc1cc(cc(OC)c1O)\C=C\C(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
ChEBI Substance ID  8143516
ChEBI URL  ChEBI:16546
ChemSpider ID  4444086
Ontomatica Chemical Accession Key (OnChAKey)  XRKBRPFTFKKHEF_DGDBGZAXSA_N_000_000000
PubChem Compound ID  5280406