Item 26 of 34 (back to results) previous next aclidinium A carboxylic ester obtained by formal condensation between the carboxy group of 2-hydroxy(di-2-thienyl)acetic acid and the hydroxy group of N-(3-phenoxypropyl)-3-quinuclidinol. Used as its bromide salt for the long-term maintenance treatment of bronchospasm associated with chronic obstructive pulmonary disease (COPD).

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > bronchodilator agent [CHEBI:35523] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   cholinergic drug [CHEBI:38323] (108)   cholinergic antagonist [CHEBI:48873] (84)   muscarinic antagonist [CHEBI:48876] (61)   aclidinium [CHEBI:65346] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   bronchodilator agent [CHEBI:35523] (34)   aclidinium [CHEBI:65346] (1) 08. Chemical Category  08. Chemical Category  ion [CHEBI:24870] (4391)   polyatomic ion [CHEBI:36358] (2633)   polyatomic cation [CHEBI:33702] (611)   ammonium ion [CHEBI:35274] (507)   quaternary ammonium ion [CHEBI:35267] (174)   aclidinium [CHEBI:65346] (1)  cation [CHEBI:36916] (947)   polyatomic cation [CHEBI:33702] (611)   ammonium ion [CHEBI:35274] (507)   quaternary ammonium ion [CHEBI:35267] (174)   aclidinium [CHEBI:65346] (1)  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   ammonium ion [CHEBI:35274] (507)   quaternary ammonium ion [CHEBI:35267] (174)   aclidinium [CHEBI:65346] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   aclidinium [CHEBI:65346] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   aclidinium [CHEBI:65346] (1)  sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   aclidinium [CHEBI:65346] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   aclidinium [CHEBI:65346] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   aclidinium [CHEBI:65346] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   aclidinium [CHEBI:65346] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   aclidinium [CHEBI:65346] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   aclidinium [CHEBI:65346] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   aclidinium [CHEBI:65346] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   aclidinium [CHEBI:65346] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   aclidinium [CHEBI:65346] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   aclidinium [CHEBI:65346] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   aclidinium [CHEBI:65346] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   aclidinium [CHEBI:65346] (1)  polyatomic ion [CHEBI:36358] (2633)   polyatomic cation [CHEBI:33702] (611)   ammonium ion [CHEBI:35274] (507)   quaternary ammonium ion [CHEBI:35267] (174)   aclidinium [CHEBI:65346] (1) ChEBI Compound Accession Identifier:   [CHEBI:65346] ChEBI Compound Description:   A carboxylic ester obtained by formal condensation between the carboxy group of 2-hydroxy(di-2-thienyl)acetic acid and the hydroxy group of N-(3-phenoxypropyl)-3-quinuclidinol. Used as its bromide salt for the long-term maintenance treatment of bronchospasm associated with chronic obstructive pulmonary disease (COPD). ChEBI Compound Identification Number:   65346 ChEBI InChI Value:   InChI=1S/C26H30NO4S2/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2/q+1/t20?,22-,27?/m0/s1 ChEBI InChIKey Value:   ASMXXROZKSBQIH-VITNCHFBSA-N ChEBI Compound Name:   aclidinium ChEBI SMILES Value:   OC(C(=O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)(c1cccs1)c1cccs1 ChEBI Substance ID:   160644942 ChEBI URL:   ChEBI:65346 ChemSpider ID:   9609381 Ontomatica Chemical Accession Key (OnChAKey):   ASMXXROZKSBQIH_VITNCHFBSA_N_000_000000 PubChem Compound ID:   11434515