Item 27 of 10027 (back to results) previous next 2,6-dinitrotoluene null

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > pnictogen molecular entity [CHEBI:33302] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   nitro compound [CHEBI:35715] (192)   C-nitro compound [CHEBI:35716] (171)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   toluenes [CHEBI:27024] (18)   nitrotoluene [CHEBI:25566] (3)   dinitrotoluene [CHEBI:23822] (2)   2,6-dinitrotoluene [CHEBI:957] (1) ChEBI Compound Accession Identifier:   [CHEBI:957] ChEBI Compound Description:   null ChEBI Compound Identification Number:   957 ChEBI InChI Value:   InChI=1S/C7H6N2O4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3 ChEBI InChIKey Value:   XTRDKALNCIHHNI-UHFFFAOYSA-N ChEBI Compound Name:   2,6-dinitrotoluene ChEBI SMILES Value:   Cc1c(cccc1[N+]([O-])=O)[N+]([O-])=O ChEBI Substance ID:   50139235 ChEBI URL:   ChEBI:957 ChemSpider ID:   11320 Ontomatica Chemical Accession Key (OnChAKey):   XTRDKALNCIHHNI_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   11813