Item 264 of 661 (back to results) previous next cystodytin F An alkaloid that is an enamide obtained by the formal condensation of 3-methylbut-2-enoic acid with 6-(2-amino-1-methoxyethyl)-4H-pyrido[2,3,4-kl]acridin-4-one. It is isolated from the Okinawan marine tunicate Cystodytes dellechiajei and exhibits cytotoxicity against human epidermoid carcinoma KB cells.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   cystodytin F [CHEBI:65712] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   cystodytin F [CHEBI:65712] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   cystodytin F [CHEBI:65712] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   cystodytin F [CHEBI:65712] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   cystodytin F [CHEBI:65712] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cystodytin F [CHEBI:65712] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   cystodytin F [CHEBI:65712] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   cystodytin F [CHEBI:65712] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cystodytin F [CHEBI:65712] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   cystodytin F [CHEBI:65712] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   cystodytin F [CHEBI:65712] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   cystodytin F [CHEBI:65712] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   cystodytin F [CHEBI:65712] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   cystodytin F [CHEBI:65712] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cystodytin F [CHEBI:65712] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   cystodytin F [CHEBI:65712] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   cystodytin F [CHEBI:65712] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   cystodytin F [CHEBI:65712] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   cystodytin F [CHEBI:65712] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   cystodytin F [CHEBI:65712] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   cystodytin F [CHEBI:65712] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   cystodytin F [CHEBI:65712] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   cystodytin F [CHEBI:65712] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   cystodytin F [CHEBI:65712] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   cystodytin F [CHEBI:65712] (1) ChEBI Compound Accession Identifier:   [CHEBI:65712] ChEBI Compound Description:   An alkaloid that is an enamide obtained by the formal condensation of 3-methylbut-2-enoic acid with 6-(2-amino-1-methoxyethyl)-4H-pyrido[2,3,4-kl]acridin-4-one. It is isolated from the Okinawan marine tunicate Cystodytes dellechiajei and exhibits cytotoxicity against human epidermoid carcinoma KB cells. ChEBI Compound Identification Number:   65712 ChEBI InChI Value:   InChI=1S/C23H21N3O3/c1-13(2)10-20(28)25-12-19(29-3)16-11-18(27)23-21-15(8-9-24-23)14-6-4-5-7-17(14)26-22(16)21/h4-11,19H,12H2,1-3H3,(H,25,28) ChEBI InChIKey Value:   RDUYTERZAINXAH-UHFFFAOYSA-N ChEBI Compound Name:   cystodytin F ChEBI SMILES Value:   COC(CNC(=O)C=C(C)C)C1=CC(=O)c2nccc3c4ccccc4nc1c23 ChEBI Substance ID:   160709503 ChEBI URL:   ChEBI:65712 ChemSpider ID:   10473435 Ontomatica Chemical Accession Key (OnChAKey):   RDUYTERZAINXAH_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   23427219