New Search

Item 265 of 3202 (back to results)
Previous previous next Next

norajmaline
An organonitrogen heterocyclic compound that is ajmaline which is lacking the methyl substituent attached to the nitrogen of the dihydroindole moiety.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Hydrolases [EC:3] (824) 
 Acting on ester bonds [EC:3.1] (313) 
 Carboxylic Ester Hydrolases [EC:3.1.1] (125) 
 Acetylajmaline esterase [EC:3.1.1.80] (7) 
 norajmaline [CHEBI:7621] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 norajmaline [CHEBI:7621] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 indole alkaloid [CHEBI:38958] (144) 
 norajmaline [CHEBI:7621] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 norajmaline [CHEBI:7621] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 norajmaline [CHEBI:7621] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 norajmaline [CHEBI:7621] (1)
 hemiaminal [CHEBI:73080] (13) 
 norajmaline [CHEBI:7621] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 norajmaline [CHEBI:7621] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 hemiaminal [CHEBI:73080] (13) 
 norajmaline [CHEBI:7621] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 hemiaminal [CHEBI:73080] (13) 
 norajmaline [CHEBI:7621] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 norajmaline [CHEBI:7621] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 indole alkaloid [CHEBI:38958] (144) 
 norajmaline [CHEBI:7621] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 norajmaline [CHEBI:7621] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 norajmaline [CHEBI:7621] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 norajmaline [CHEBI:7621] (1)
 hemiaminal [CHEBI:73080] (13) 
 norajmaline [CHEBI:7621] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 hemiaminal [CHEBI:73080] (13) 
 norajmaline [CHEBI:7621] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 norajmaline [CHEBI:7621] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 norajmaline [CHEBI:7621] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 norajmaline [CHEBI:7621] (1)
 hemiaminal [CHEBI:73080] (13) 
 norajmaline [CHEBI:7621] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 norajmaline [CHEBI:7621] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 bridged compound [CHEBI:35990] (118) 
 norajmaline [CHEBI:7621] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 norajmaline [CHEBI:7621] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 norajmaline [CHEBI:7621] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 norajmaline [CHEBI:7621] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 norajmaline [CHEBI:7621] (1)
ChEBI Compound Accession Identifier  [CHEBI:7621]
ChEBI Compound Description  An organonitrogen heterocyclic compound that is ajmaline which is lacking the methyl substituent attached to the nitrogen of the dihydroindole moiety.
ChEBI Compound Identification Number  7621
ChEBI InChI Value  InChI=1S/C19H24N2O2/c1-2-9-10-7-13-16-19(11-5-3-4-6-12(11)20-16)8-14(15(10)17(19)22)21(13)18(9)23/h3-6,9-10,13-18,20,22-23H,2,7-8H2,1H3/t9-,10-,13-,14-,15-,16-,17+,18+,19+/m0/s1
ChEBI InChIKey Value  HIOAYNMZFIHQNS-DEKAJGEMSA-N
ChEBI Compound Name  norajmaline
ChEBI SMILES Value  [H][C@@]12[C@H]3C[C@]4([H])N([C@H](O)[C@H]3CC)[C@H]1C[C@@]1([C@@H]2O)c2ccccc2N[C@@]41[H]
ChEBI Substance ID  8145939
ChEBI URL  ChEBI:7621
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  HIOAYNMZFIHQNS_DEKAJGEMSA_N_000_000000
PubChem Compound ID  24893138