New Search

Item 267 of 1930 (back to results)
Previous previous next Next

hydralazine
"The 1-hydrazino derivative of phthalazine; a direct-acting vasodilator that is used as an antihypertensive agent."


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antihypertensive agent [CHEBI:35674] (104) 
 hydralazine [CHEBI:5775] (1)
 cardiovascular drug [CHEBI:35554] (162) 
 vasodilator agent [CHEBI:35620] (65) 
 hydralazine [CHEBI:5775] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 hydrazines [CHEBI:24631] (17) 
 hydralazine [CHEBI:5775] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 fused compound [CHEBI:35293] (113) 
 ortho-fused compound [CHEBI:33637] (83) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 phthalazines [CHEBI:38768] (6) 
 hydralazine [CHEBI:5775] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 ortho-fused heteroarene [CHEBI:52362] (16) 
 hydralazine [CHEBI:5775] (1)
 azaarene [CHEBI:50893] (90) 
 hydralazine [CHEBI:5775] (1)
ChEBI Compound Accession Identifier  [CHEBI:5775]
ChEBI Compound Description  "The 1-hydrazino derivative of phthalazine; a direct-acting vasodilator that is used as an antihypertensive agent."
ChEBI Compound Identification Number  5775
ChEBI InChI Value  InChI=1S/C8H8N4/c9-11-8-7-4-2-1-3-6(7)5-10-12-8/h1-5H,9H2,(H,11,12)
ChEBI InChIKey Value  RPTUSVTUFVMDQK-UHFFFAOYSA-N
ChEBI Compound Name  hydralazine
ChEBI SMILES Value  NNc1nncc2ccccc12
ChEBI Substance ID  99437371
ChEBI URL  ChEBI:5775
ChemSpider ID  3511
Ontomatica Chemical Accession Key (OnChAKey)  RPTUSVTUFVMDQK_UHFFFAOYSA_N_000_000000
PubChem Compound ID  3637