New Search

Item 270 of 3202 (back to results)
Previous previous next Next

oxazepam
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 oxazepam [CHEBI:7823] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 oxazepam [CHEBI:7823] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 oxazepam [CHEBI:7823] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 1,4-benzodiazepinone [CHEBI:35500] (12) 
 oxazepam [CHEBI:7823] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 oxazepam [CHEBI:7823] (1)
ChEBI Compound Accession Identifier  [CHEBI:7823]
ChEBI Compound Description  null
ChEBI Compound Identification Number  7823
ChEBI InChI Value  InChI=1S/C15H11ClN2O2/c16-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)18-15(20)14(19)17-12/h1-8,15,20H,(H,17,19)
ChEBI InChIKey Value  ADIMAYPTOBDMTL-UHFFFAOYSA-N
ChEBI Compound Name  oxazepam
ChEBI SMILES Value  OC1N=C(c2ccccc2)c2cc(Cl)ccc2NC1=O
ChEBI Substance ID  8145938
ChEBI URL  ChEBI:7823
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  ADIMAYPTOBDMTL_UHFFFAOYSA_N_000_000000
PubChem Compound ID  4616