Item 28 of 108 (back to results) previous next anolignan B A lignan that consists of buta-1,3-diene substituted by 4-hydroxybenzyl groups at positions 2 and 3. It is isolated from the ground stems of Anogeissus acuminata and exhibits anti-HIV activity by inhibiting HIV-1 reverse transcriptase enzyme.

Current search: 06. Name of Biological Source of Chemical: Plantae > Magnoliophyta × 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   anolignan B [CHEBI:65411] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HIV agent [CHEBI:64946] (126)   anti-HIV-1 agent [CHEBI:64947] (79)   HIV-1 reverse transcriptase inhibitor [CHEBI:53756] (30)   anolignan B [CHEBI:65411] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Myrtales (33)   Combretaceae (25)   Anogeissus (2)   Anogeissus acuminata (2) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   shoot axis [PO:0025029] (271)   stem [PO:0009047] (170) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   anolignan B [CHEBI:65411] (1)  phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   anolignan B [CHEBI:65411] (1)  phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   anolignan B [CHEBI:65411] (1)  phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   anolignan B [CHEBI:65411] (1)  phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anolignan B [CHEBI:65411] (1) ChEBI Compound Accession Identifier:   [CHEBI:65411] ChEBI Compound Description:   A lignan that consists of buta-1,3-diene substituted by 4-hydroxybenzyl groups at positions 2 and 3. It is isolated from the ground stems of Anogeissus acuminata and exhibits anti-HIV activity by inhibiting HIV-1 reverse transcriptase enzyme. ChEBI Compound Identification Number:   65411 ChEBI InChI Value:   InChI=1S/C18H18O2/c1-13(11-15-3-7-17(19)8-4-15)14(2)12-16-5-9-18(20)10-6-16/h3-10,19-20H,1-2,11-12H2 ChEBI InChIKey Value:   VVKZAZVVUAFFGF-UHFFFAOYSA-N ChEBI Compound Name:   anolignan B ChEBI SMILES Value:   Oc1ccc(CC(=C)C(=C)Cc2ccc(O)cc2)cc1 ChEBI Substance ID:   160645053 ChEBI URL:   ChEBI:65411 ChemSpider ID:   65322 Ontomatica Chemical Accession Key (OnChAKey):   VVKZAZVVUAFFGF_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   72388