New Search

Item 29 of 59 (back to results)
Previous previous next Next

callophycoic acid F
An organic heterobicyclic compound that is 2,5-dihydro-1-benzoxepine-7-carboxylic acid substituted by a (3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl group at position 3. It is isolated from the Fijian red alga Callophycus serratus and exhibits antibacterial, antimalarial and anticancer activities.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 callophycoic acid F [CHEBI:65562] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antibacterial agent [CHEBI:33282] (317) 
 callophycoic acid F [CHEBI:65562] (1)
 antimicrobial drug [CHEBI:36043] (169) 
 antiprotozoal drug [CHEBI:35820] (168) 
 antimalarial [CHEBI:38068] (89) 
 callophycoic acid F [CHEBI:65562] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 callophycoic acid F [CHEBI:65562] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 diterpenoid [CHEBI:23849] (265) 
 callophycoic acid F [CHEBI:65562] (1)
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 diterpenoid [CHEBI:23849] (265) 
 callophycoic acid F [CHEBI:65562] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 callophycoic acid F [CHEBI:65562] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 callophycoic acid F [CHEBI:65562] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 callophycoic acid F [CHEBI:65562] (1)
ChEBI Compound Accession Identifier  [CHEBI:65562]
ChEBI Compound Description  An organic heterobicyclic compound that is 2,5-dihydro-1-benzoxepine-7-carboxylic acid substituted by a (3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl group at position 3. It is isolated from the Fijian red alga Callophycus serratus and exhibits antibacterial, antimalarial and anticancer activities.
ChEBI Compound Identification Number  65562
ChEBI InChI Value  InChI=1S/C27H36O3/c1-20(2)8-5-9-21(3)10-6-11-22(4)12-7-13-23-14-15-24-18-25(27(28)29)16-17-26(24)30-19-23/h8,10,12,14,16-18H,5-7,9,11,13,15,19H2,1-4H3,(H,28,29)/b21-10+,22-12+
ChEBI InChIKey Value  URXNJUNXUWLMAY-KZVLYIKRSA-N
ChEBI Compound Name  callophycoic acid F
ChEBI SMILES Value  CC(C)=CCC\C(C)=C\CC\C(C)=C\CCC1=CCc2cc(ccc2OC1)C(O)=O
ChEBI Substance ID  160655741
ChEBI URL  ChEBI:65562
ChemSpider ID  23076458
Ontomatica Chemical Accession Key (OnChAKey)  URXNJUNXUWLMAY_KZVLYIKRSA_N_000_000000
PubChem Compound ID  23584315