Item 30 of 2691 (back to results) previous next D-pantetheine 4'-phosphate Pantetheine 4'-phosphate with D (R) configuration at the 2' position.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > pnictogen molecular entity [CHEBI:33302] > phosphorus molecular entity [CHEBI:26082] > phosphorus oxoacids and derivatives [CHEBI:36360] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   cofactor [CHEBI:23357] (40)   prosthetic group [CHEBI:26348] (10)   D-pantetheine 4'-phosphate [CHEBI:4222] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   phosphorus molecular entity [CHEBI:26082] (2769)   organophosphorus compound [CHEBI:25710] (1528)   organic phosphate [CHEBI:25703] (1511)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  phosphorus oxoacids and derivatives [CHEBI:36360] (2691)   phosphorus oxoacid derivative [CHEBI:36359] (2628)   phosphoric acid derivative [CHEBI:26079] (2611)   organic phosphate [CHEBI:25703] (1511)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  phosphate [CHEBI:26020] (1522)   organic phosphate [CHEBI:25703] (1511)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  phosphoric ester [CHEBI:37734] (1466)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organophosphorus compound [CHEBI:25710] (1528)   organic phosphate [CHEBI:25703] (1511)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  ester [CHEBI:35701] (3370)   phosphoric ester [CHEBI:37734] (1466)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  oxoacid derivative [CHEBI:33241] (3254)   phosphorus oxoacid derivative [CHEBI:36359] (2628)   phosphoric acid derivative [CHEBI:26079] (2611)   organic phosphate [CHEBI:25703] (1511)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  phosphate [CHEBI:26020] (1522)   organic phosphate [CHEBI:25703] (1511)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1)  phosphoric ester [CHEBI:37734] (1466)   amidoalkyl phosphate [CHEBI:37481] (7)   phosphopantetheine [CHEBI:26073] (3)   pantetheine 4'-phosphate [CHEBI:16858] (2)   D-pantetheine 4'-phosphate [CHEBI:4222] (1) ChEBI Compound Accession Identifier:   [CHEBI:4222] ChEBI Compound Description:   Pantetheine 4'-phosphate with D (R) configuration at the 2' position. ChEBI Compound Identification Number:   4222 ChEBI InChI Value:   InChI=1S/C11H23N2O7PS/c1-11(2,7-20-21(17,18)19)9(15)10(16)13-4-3-8(14)12-5-6-22/h9,15,22H,3-7H2,1-2H3,(H,12,14)(H,13,16)(H2,17,18,19)/t9-/m0/s1 ChEBI InChIKey Value:   JDMUPRLRUUMCTL-VIFPVBQESA-N ChEBI Compound Name:   D-pantetheine 4'-phosphate ChEBI SMILES Value:   CC(C)(COP(O)(O)=O)[C@@H](O)C(=O)NCCC(=O)NCCS ChEBI Substance ID:   121269843 ChEBI URL:   ChEBI:4222 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   JDMUPRLRUUMCTL_VIFPVBQESA_N_000_000000 PubChem Compound ID:   115254