Item 30 of 103 (back to results) previous next alvaradoin M A C-glycosyl compound that is 1,8-dihydroxy-3-methylanthracen-9(10H)-one substituted by a 3-O-senecioyl-alpha-L-lyxopyranosyl moiety at position 10 via a C-glycosidic linkage (the 10S stereoisomer). It is isolated from the leaves of Alvaradoa haitiensis and exhibits cytotoxicity against human oral epidermoid carcinoma.

Current search: 07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496] > plant organ [PO:0009008] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   alvaradoin M [CHEBI:65398] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   alvaradoin M [CHEBI:65398] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Sapindales (202)   Simaroubaceae (20)   Alvaradoa haitiensis  (10) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   phyllome [PO:0006001] (351)   leaf [PO:0025034] (351) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1)  organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   alvaradoin M [CHEBI:65398] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   alvaradoin M [CHEBI:65398] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   alvaradoin M [CHEBI:65398] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   alvaradoin M [CHEBI:65398] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   alvaradoin M [CHEBI:65398] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   alvaradoin M [CHEBI:65398] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   alvaradoin M [CHEBI:65398] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   alvaradoin M [CHEBI:65398] (1) ChEBI Compound Accession Identifier:   [CHEBI:65398] ChEBI Compound Description:   A C-glycosyl compound that is 1,8-dihydroxy-3-methylanthracen-9(10H)-one substituted by a 3-O-senecioyl-alpha-L-lyxopyranosyl moiety at position 10 via a C-glycosidic linkage (the 10S stereoisomer). It is isolated from the leaves of Alvaradoa haitiensis and exhibits cytotoxicity against human oral epidermoid carcinoma. ChEBI Compound Identification Number:   65398 ChEBI InChI Value:   InChI=1S/C25H26O9/c1-10(2)7-16(28)33-24-21(30)23(34-25(32)22(24)31)17-12-5-4-6-14(26)18(12)20(29)19-13(17)8-11(3)9-15(19)27/h4-9,17,21-27,30-32H,1-3H3/t17-,21-,22+,23-,24+,25+/m0/s1 ChEBI InChIKey Value:   XVEVCPOACUOIOH-AEPXPHGDSA-N ChEBI Compound Name:   alvaradoin M ChEBI SMILES Value:   [H][C@]1(O[C@@H](O)[C@H](O)[C@H](OC(=O)C=C(C)C)[C@H]1O)[C@@]1([H])c2cccc(O)c2C(=O)c2c(O)cc(C)cc12 ChEBI Substance ID:   160645153 ChEBI URL:   ChEBI:65398 ChemSpider ID:   20567913 Ontomatica Chemical Accession Key (OnChAKey):   XVEVCPOACUOIOH_AEPXPHGDSA_N_000_000000 PubChem Compound ID:   16736466