New Search

Item 4 of 7 (back to results)
Previous previous next Next

4-methoxyphenylacetic acid
A phenylacetic acid molecule carrying a 4-methoxy substituent, used as an intermediate for pharmaceuticals and other organic synthesis.


Current search:

05. Industrial Uses: agrochemical [CHEBI:33286]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pesticide [CHEBI:25944] (211) 
 herbicide [CHEBI:24527] (48) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 agrochemical [CHEBI:33286] (142) 
 fertilizer [CHEBI:33287] (6) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 4-methoxyphenylacetic acid [CHEBI:55501] (1)
ChEBI Compound Accession Identifier  [CHEBI:55501]
ChEBI Compound Description  A phenylacetic acid molecule carrying a 4-methoxy substituent, used as an intermediate for pharmaceuticals and other organic synthesis.
ChEBI Compound Identification Number  55501
ChEBI InChI Value  InChI=1S/C9H10O3/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11)
ChEBI InChIKey Value  NRPFNQUDKRYCNX-UHFFFAOYSA-N
ChEBI Compound Name  4-methoxyphenylacetic acid
ChEBI SMILES Value  COc1ccc(CC(O)=O)cc1
ChEBI Substance ID  92741057
ChEBI URL  ChEBI:55501
ChemSpider ID  7406
Ontomatica Chemical Accession Key (OnChAKey)  NRPFNQUDKRYCNX_UHFFFAOYSA_N_000_000000
PubChem Compound ID  7690