Item 4 of 126 (back to results) previous next apramycin An aminoglycoside that is 2-deoxystreptamine that is substituted on the oxygen at position 4 by an (8R)-2-amino-8-O-(4-amino-4-deoxy-alpha-D-glucopyranosyl)-2,3,7-trideoxy-7-(methylamino)-D-glycero-alpha-D-allo-octodialdo-1,5:8,4-dipyranos-1-yl) group.

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] > heterocyclic compound [CHEBI:5686] > heterobicyclic compound [CHEBI:33672] > organic heterobicyclic compound [CHEBI:27171] × 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   apramycin [CHEBI:2790] (1)  antibacterial agent [CHEBI:33282] (317)   antibacterial drug [CHEBI:36047] (177)   apramycin [CHEBI:2790] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   cyclitol [CHEBI:23451] (149)   amino cyclitol [CHEBI:61689] (9)   2-deoxystreptamine derivative [CHEBI:61800] (1)   apramycin [CHEBI:2790] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   cyclitol [CHEBI:23451] (149)   amino cyclitol [CHEBI:61689] (9)   2-deoxystreptamine derivative [CHEBI:61800] (1)   apramycin [CHEBI:2790] (1)  organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   aminoglycoside [CHEBI:47779] (66)   apramycin [CHEBI:2790] (1)  carbohydrate derivative [CHEBI:63299] (2582)   aminoglycoside [CHEBI:47779] (66)   apramycin [CHEBI:2790] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   aminoglycoside [CHEBI:47779] (66)   apramycin [CHEBI:2790] (1)  carbohydrate derivative [CHEBI:63299] (2582)   aminoglycoside [CHEBI:47779] (66)   apramycin [CHEBI:2790] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   glycoside [CHEBI:24400] (633)   aminoglycoside [CHEBI:47779] (66)   apramycin [CHEBI:2790] (1)  carbohydrate derivative [CHEBI:63299] (2582)   aminoglycoside [CHEBI:47779] (66)   apramycin [CHEBI:2790] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   cyclitol [CHEBI:23451] (149)   amino cyclitol [CHEBI:61689] (9)   2-deoxystreptamine derivative [CHEBI:61800] (1)   apramycin [CHEBI:2790] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   apramycin [CHEBI:2790] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   cyclitol [CHEBI:23451] (149)   amino cyclitol [CHEBI:61689] (9)   2-deoxystreptamine derivative [CHEBI:61800] (1)   apramycin [CHEBI:2790] (1) ChEBI Compound Accession Identifier:   [CHEBI:2790] ChEBI Compound Description:   An aminoglycoside that is 2-deoxystreptamine that is substituted on the oxygen at position 4 by an (8R)-2-amino-8-O-(4-amino-4-deoxy-alpha-D-glucopyranosyl)-2,3,7-trideoxy-7-(methylamino)-D-glycero-alpha-D-allo-octodialdo-1,5:8,4-dipyranos-1-yl) group. ChEBI Compound Identification Number:   2790 ChEBI InChI Value:   InChI=1S/C21H41N5O11/c1-26-11-14(30)18-8(33-20(11)37-21-16(32)13(29)10(25)9(4-27)34-21)3-7(24)19(36-18)35-17-6(23)2-5(22)12(28)15(17)31/h5-21,26-32H,2-4,22-25H2,1H3/t5-,6+,7-,8+,9-,10-,11+,12+,13+,14-,15-,16-,17-,18+,19+,20-,21-/m1/s1 ChEBI InChIKey Value:   XZNUGFQTQHRASN-XQENGBIVSA-N ChEBI Compound Name:   apramycin ChEBI SMILES Value:   [H][C@]12C[C@@H](N)[C@@H](O[C@@H]3[C@@H](N)C[C@@H](N)[C@H](O)[C@H]3O)O[C@]1([H])[C@H](O)[C@H](NC)[C@@H](O[C@H]1O[C@H](CO)[C@@H](N)[C@H](O)[C@H]1O)O2 ChEBI Substance ID:   121269842 ChEBI URL:   ChEBI:2790 ChemSpider ID:   2339128 Ontomatica Chemical Accession Key (OnChAKey):   XZNUGFQTQHRASN_XQENGBIVSA_N_000_000000 PubChem Compound ID:   3081545