Item 4 of 185 (back to results) previous next azelastine A phthalazine compound having an oxo substituent at the 1-position, a 1-methylazepan-4-yl group at the 2-position and a 4-chlorobenzyl substituent at the 4-position.

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > heteroatomic molecular entity [CHEBI:37577] > halide [CHEBI:37578] > organohalogen compound [CHEBI:36684] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   lipoxygenase inhibitor [CHEBI:35856] (23)   arachidonate 5-lipoxygenase inhibitor [CHEBI:64964] (9)   azelastine [CHEBI:2950] (1)  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   histaminergic drug [CHEBI:37957] (94)   histamine antagonist [CHEBI:37956] (87)   H1-receptor antagonist [CHEBI:37955] (57)   azelastine [CHEBI:2950] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   anti-asthmatic drug [CHEBI:49167] (25)   azelastine [CHEBI:2950] (1)  hematologic agent [CHEBI:50248] (64)   platelet aggregation inhibitor [CHEBI:50427] (39)   azelastine [CHEBI:2950] (1)  anti-allergic agent [CHEBI:50857] (51)   azelastine [CHEBI:2950] (1)  bronchodilator agent [CHEBI:35523] (34)   azelastine [CHEBI:2950] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   azelastine [CHEBI:2950] (3)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   azelastine [CHEBI:2950] (3)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   azelastine [CHEBI:2950] (3)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   azelastine [CHEBI:2950] (3)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   azelastine [CHEBI:2950] (3)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   azelastine [CHEBI:2950] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   phthalazines [CHEBI:38768] (6)   azelastine [CHEBI:2950] (3)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   azelastine [CHEBI:2950] (3) ChEBI Compound Accession Identifier:   [CHEBI:2950] ChEBI Compound Description:   A phthalazine compound having an oxo substituent at the 1-position, a 1-methylazepan-4-yl group at the 2-position and a 4-chlorobenzyl substituent at the 4-position. ChEBI Compound Identification Number:   2950 ChEBI InChI Value:   InChI=1S/C22H24ClN3O/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16/h2-3,6-11,18H,4-5,12-15H2,1H3 ChEBI InChIKey Value:   MBUVEWMHONZEQD-UHFFFAOYSA-N ChEBI Compound Name:   azelastine ChEBI SMILES Value:   CN1CCCC(CC1)n1nc(Cc2ccc(Cl)cc2)c2ccccc2c1=O ChEBI Substance ID:   87350406 ChEBI URL:   ChEBI:2950 ChemSpider ID:   2180 Ontomatica Chemical Accession Key (OnChAKey):   MBUVEWMHONZEQD_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2267