Item 4 of 5 (back to results) previous next negundin B A lignan that consists of 7,8-dihydronaphthalen-2-ol substituted by a 4-hydroxy-3-methoxyphenyl group at position 8, hydroxymethyl groups at positions 6 and 7 and a methoxy group at position 3 (the 7R,8S stereoisomer). Isolated from Vitex negundo, it exhibits inhibitory activity against lipoxygenase.

Current search: 07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > lipoxygenase inhibitor [CHEBI:35856] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   lipoxygenase inhibitor [CHEBI:35856] (23)   negundin B [CHEBI:66613] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   negundin B [CHEBI:66613] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Lamiales (196)   Lamiaceae (156)   Vitex (1)   Vitex negundo (1) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   root [PO:0009005] (486) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   negundin B [CHEBI:66613] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   negundin B [CHEBI:66613] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   negundin B [CHEBI:66613] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   negundin B [CHEBI:66613] (1)  benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   negundin B [CHEBI:66613] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   negundin B [CHEBI:66613] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   negundin B [CHEBI:66613] (1) ChEBI Compound Accession Identifier:   [CHEBI:66613] ChEBI Compound Description:   A lignan that consists of 7,8-dihydronaphthalen-2-ol substituted by a 4-hydroxy-3-methoxyphenyl group at position 8, hydroxymethyl groups at positions 6 and 7 and a methoxy group at position 3 (the 7R,8S stereoisomer). Isolated from Vitex negundo, it exhibits inhibitory activity against lipoxygenase. ChEBI Compound Identification Number:   66613 ChEBI InChI Value:   InChI=1S/C20H22O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-8,15,20-24H,9-10H2,1-2H3/t15-,20-/m0/s1 ChEBI InChIKey Value:   AKOLXLNVZGAYAV-YWZLYKJASA-N ChEBI Compound Name:   negundin B ChEBI SMILES Value:   [H][C@]1([C@@H](CO)C(CO)=Cc2cc(OC)c(O)cc12)c1ccc(O)c(OC)c1 ChEBI Substance ID:   160710539 ChEBI URL:   ChEBI:66613 ChemSpider ID:   8648980 Ontomatica Chemical Accession Key (OnChAKey):   AKOLXLNVZGAYAV_YWZLYKJASA_N_000_000000 PubChem Compound ID:   10473569