New Search

Item 4 of 4 (back to results)
Previous previous

carmoxirole
An indolecarboxylic acid that is indole-5-carboxylic acid bearing an additional 4-(4-phenyl-1,2,3,6-tetrahydropyridin-1-yl)butyl substituent at position 3. Selective, peripherally acting dopamine D2 receptor agonist. Modulates noradrenalin release and sympathetic activation. Displays antihypertensive properties in vivo.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > hematologic agent [CHEBI:50248]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 dopaminergic agent [CHEBI:48560] (99) 
 dopamine agonist [CHEBI:51065] (26) 
 carmoxirole [CHEBI:64200] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antihypertensive agent [CHEBI:35674] (104) 
 carmoxirole [CHEBI:64200] (1)
 hematologic agent [CHEBI:50248] (64) 
 platelet aggregation inhibitor [CHEBI:50427] (39) 
 carmoxirole [CHEBI:64200] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 carmoxirole [CHEBI:64200] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 carmoxirole [CHEBI:64200] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 carmoxirole [CHEBI:64200] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 pyridines [CHEBI:26421] (254) 
 tetrahydropyridine [CHEBI:26921] (10) 
 carmoxirole [CHEBI:64200] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 indolecarboxylic acid [CHEBI:38610] (1) 
 carmoxirole [CHEBI:64200] (1)
ChEBI Compound Accession Identifier  [CHEBI:64200]
ChEBI Compound Description  An indolecarboxylic acid that is indole-5-carboxylic acid bearing an additional 4-(4-phenyl-1,2,3,6-tetrahydropyridin-1-yl)butyl substituent at position 3. Selective, peripherally acting dopamine D2 receptor agonist. Modulates noradrenalin release and sympathetic activation. Displays antihypertensive properties in vivo.
ChEBI Compound Identification Number  64200
ChEBI InChI Value  InChI=1S/C24H26N2O2/c27-24(28)20-9-10-23-22(16-20)21(17-25-23)8-4-5-13-26-14-11-19(12-15-26)18-6-2-1-3-7-18/h1-3,6-7,9-11,16-17,25H,4-5,8,12-15H2,(H,27,28)
ChEBI InChIKey Value  AFSOIHMEOKEZJF-UHFFFAOYSA-N
ChEBI Compound Name  carmoxirole
ChEBI SMILES Value  OC(=O)c1ccc2[nH]cc(CCCCN3CCC(=CC3)c3ccccc3)c2c1
ChEBI Substance ID  135610756
ChEBI URL  ChEBI:64200
ChemSpider ID  51715
Ontomatica Chemical Accession Key (OnChAKey)  AFSOIHMEOKEZJF_UHFFFAOYSA_N_000_000000
PubChem Compound ID  57364