Item 4 of 4 (back to results) previous carmoxirole An indolecarboxylic acid that is indole-5-carboxylic acid bearing an additional 4-(4-phenyl-1,2,3,6-tetrahydropyridin-1-yl)butyl substituent at position 3. Selective, peripherally acting dopamine D2 receptor agonist. Modulates noradrenalin release and sympathetic activation. Displays antihypertensive properties in vivo.

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > hematologic agent [CHEBI:50248] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   dopaminergic agent [CHEBI:48560] (99)   dopamine agonist [CHEBI:51065] (26)   carmoxirole [CHEBI:64200] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antihypertensive agent [CHEBI:35674] (104)   carmoxirole [CHEBI:64200] (1)  hematologic agent [CHEBI:50248] (64)   platelet aggregation inhibitor [CHEBI:50427] (39)   carmoxirole [CHEBI:64200] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   carmoxirole [CHEBI:64200] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   carmoxirole [CHEBI:64200] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   carmoxirole [CHEBI:64200] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  pyridines [CHEBI:26421] (254)   tetrahydropyridine [CHEBI:26921] (10)   carmoxirole [CHEBI:64200] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   indolecarboxylic acid [CHEBI:38610] (1)   carmoxirole [CHEBI:64200] (1) ChEBI Compound Accession Identifier:   [CHEBI:64200] ChEBI Compound Description:   An indolecarboxylic acid that is indole-5-carboxylic acid bearing an additional 4-(4-phenyl-1,2,3,6-tetrahydropyridin-1-yl)butyl substituent at position 3. Selective, peripherally acting dopamine D2 receptor agonist. Modulates noradrenalin release and sympathetic activation. Displays antihypertensive properties in vivo. ChEBI Compound Identification Number:   64200 ChEBI InChI Value:   InChI=1S/C24H26N2O2/c27-24(28)20-9-10-23-22(16-20)21(17-25-23)8-4-5-13-26-14-11-19(12-15-26)18-6-2-1-3-7-18/h1-3,6-7,9-11,16-17,25H,4-5,8,12-15H2,(H,27,28) ChEBI InChIKey Value:   AFSOIHMEOKEZJF-UHFFFAOYSA-N ChEBI Compound Name:   carmoxirole ChEBI SMILES Value:   OC(=O)c1ccc2[nH]cc(CCCCN3CCC(=CC3)c3ccccc3)c2c1 ChEBI Substance ID:   135610756 ChEBI URL:   ChEBI:64200 ChemSpider ID:   51715 Ontomatica Chemical Accession Key (OnChAKey):   AFSOIHMEOKEZJF_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   57364