| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
codeine [CHEBI:16714] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:16714] |
| ChEBI Compound Description: |
"Codeine is an alkaloid found in the opium poppy, Papaver somniferum var. album; has analgesic, anti-tussive and anti-diarrhoeal properties." |
| ChEBI Compound Identification Number: |
16714 |
| ChEBI InChI Value: |
InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3-6,11-13,17,20H,7-9H2,1-2H3/t11-,12+,13-,17-,18-/m0/s1 |
| ChEBI InChIKey Value: |
OROGSEYTTFOCAN-DNJOTXNNSA-N |
| ChEBI Compound Name: |
codeine |
| ChEBI SMILES Value: |
[H][C@]12C=C[C@H](O)[C@@H]3Oc4c(OC)ccc5C[C@H]1N(C)CC[C@@]23c45 |
| ChEBI Substance ID: |
8144934 |
| ChEBI URL: |
ChEBI:16714 |
| ChemSpider ID: |
4447447 |
| Ontomatica Chemical Accession Key (OnChAKey): |
OROGSEYTTFOCAN_DNJOTXNNSA_N_000_000000 |
| PubChem Compound ID: |
5284371 |