New Search

Item 4 of 11 (back to results)
Previous previous next Next

perphenazine
A phenothiazine derivative having a chloro subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > dopaminergic agent [CHEBI:48560]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 dopaminergic agent [CHEBI:48560] (99) 
 dopaminergic antagonist [CHEBI:48561] (48) 
 perphenazine [CHEBI:8028] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 tranquilizing drug [CHEBI:35473] (83) 
 antipsychotic agent [CHEBI:35476] (51) 
 first generation antipsychotic [CHEBI:65190] (30) 
 phenothiazine antipsychotic drug [CHEBI:37930] (18) 
 perphenazine [CHEBI:8028] (1)
 antiemetic [CHEBI:50919] (41) 
 perphenazine [CHEBI:8028] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 amino alcohol [CHEBI:22478] (250) 
 ethanolamines [CHEBI:23981] (167) 
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino alcohol [CHEBI:22478] (250) 
 ethanolamines [CHEBI:23981] (167) 
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 amino alcohol [CHEBI:22478] (250) 
 ethanolamines [CHEBI:23981] (167) 
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino alcohol [CHEBI:22478] (250) 
 ethanolamines [CHEBI:23981] (167) 
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 amino alcohol [CHEBI:22478] (250) 
 ethanolamines [CHEBI:23981] (167) 
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino alcohol [CHEBI:22478] (250) 
 ethanolamines [CHEBI:23981] (167) 
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 perphenazine [CHEBI:8028] (1)
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 perphenazine [CHEBI:8028] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 amino alcohol [CHEBI:22478] (250) 
 ethanolamines [CHEBI:23981] (167) 
 N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6) 
 perphenazine [CHEBI:8028] (1)
ChEBI Compound Accession Identifier  [CHEBI:8028]
ChEBI Compound Description  A phenothiazine derivative having a chloro subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position.
ChEBI Compound Identification Number  8028
ChEBI InChI Value  InChI=1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2
ChEBI InChIKey Value  RGCVKNLCSQQDEP-UHFFFAOYSA-N
ChEBI Compound Name  perphenazine
ChEBI SMILES Value  OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc23)CC1
ChEBI Substance ID  24434791
ChEBI URL  ChEBI:8028
ChemSpider ID  4586
Ontomatica Chemical Accession Key (OnChAKey)  RGCVKNLCSQQDEP_UHFFFAOYSA_N_000_000000
PubChem Compound ID  4748