Select any link to see items in a related category.
more general categories information about this item 03. Biological Effects of Specific Chemicals 03. Biological Effects of Specific Chemicals biochemical uses [CHEBI:52206] (3306) metabolite [CHEBI:25212] (2692) secondary metabolite [CHEBI:26619] (2225) phenylacetic acid [CHEBI:30745] (1) molecular messenger [CHEBI:33280] (92) hormone [CHEBI:24621] (55) phytohormone [CHEBI:37848] (22) phenylacetic acid [CHEBI:30745] (1) growth regulator [CHEBI:39317] (34) plant growth regulator [CHEBI:26155] (21) auxin [CHEBI:22676] (6) phenylacetic acid [CHEBI:30745] (1) 06. Name of Biological Source of Chemical 06. Name of Biological Source of Chemical Fungi, Yeasts, Molds and Mildews (348) Deuteromycotina (255) Hyphomycetes (137) Stachylidium (9) 07. Part of Biological Source of Chemical 07. Part of Biological Source of Chemical unspecified structure [PO:0000004] (703) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) p-block molecular entity [CHEBI:33675] (25343) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) heteroorganic entity [CHEBI:33285] (15197) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) cyclic compound [CHEBI:33595] (7817) homocyclic compound [CHEBI:33597] (1134) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) aromatic compound [CHEBI:33655] (3799) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) phenylacetic acid [CHEBI:30745] (1) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) phenylacetic acid [CHEBI:30745] (1) ChEBI Compound Accession Identifier: [CHEBI:30745] ChEBI Compound Description: Benzene to which is attached a carboxymethyl functional group. ChEBI Compound Identification Number: 30745 ChEBI InChI Value: InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) ChEBI InChIKey Value: WLJVXDMOQOGPHL-UHFFFAOYSA-N ChEBI Compound Name: phenylacetic acid ChEBI SMILES Value: OC(=O)Cc1ccccc1 ChEBI Substance ID: 8145242 ChEBI URL: ChEBI:30745 ChemSpider ID: 10181341 Ontomatica Chemical Accession Key (OnChAKey): WLJVXDMOQOGPHL_UHFFFAOYSA_N_000_000000 PubChem Compound ID: 999
