Item 31 of 43 (back to results) previous next isariotin F An organic heterobicyclic compound that is a lactol isolated from the entomopathogenic fungus Isaria tenuipes and exhibits antimalarial and antineoplastic activities.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   isariotin F [CHEBI:66086] (1)  antimicrobial agent [CHEBI:33281] (927)   antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antimalarial [CHEBI:38068] (89)   isariotin F [CHEBI:66086] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   isariotin F [CHEBI:66086] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   isariotin F [CHEBI:66086] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   isariotin F [CHEBI:66086] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   isariotin F [CHEBI:66086] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   isariotin F [CHEBI:66086] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   isariotin F [CHEBI:66086] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   isariotin F [CHEBI:66086] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   isariotin F [CHEBI:66086] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   isariotin F [CHEBI:66086] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   isariotin F [CHEBI:66086] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   isariotin F [CHEBI:66086] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   isariotin F [CHEBI:66086] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   isariotin F [CHEBI:66086] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   isariotin F [CHEBI:66086] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   alpha,beta-unsaturated monocarboxylic acid amide [CHEBI:51750] (23)   enamide [CHEBI:51751] (20)   isariotin F [CHEBI:66086] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   isariotin F [CHEBI:66086] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   isariotin F [CHEBI:66086] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   isariotin F [CHEBI:66086] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   isariotin F [CHEBI:66086] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   isariotin F [CHEBI:66086] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   isariotin F [CHEBI:66086] (1) ChEBI Compound Accession Identifier:   [CHEBI:66086] ChEBI Compound Description:   An organic heterobicyclic compound that is a lactol isolated from the entomopathogenic fungus Isaria tenuipes and exhibits antimalarial and antineoplastic activities. ChEBI Compound Identification Number:   66086 ChEBI InChI Value:   InChI=1S/C21H32ClNO5/c1-2-3-4-5-6-7-8-9-10-11-18(25)23-16-14-21(27)17(24)13-12-15(22)19(21)28-20(16)26/h10-13,15-16,19-20,26-27H,2-9,14H2,1H3,(H,23,25)/b11-10+/t15-,16+,19+,20-,21-/m1/s1 ChEBI InChIKey Value:   BQBLZAMUHGIEFL-JRVIZFGFSA-N ChEBI Compound Name:   isariotin F ChEBI SMILES Value:   [H][C@@]12O[C@@H](O)[C@H](C[C@@]1(O)C(=O)C=C[C@H]2Cl)NC(=O)\C=C\CCCCCCCCC ChEBI Substance ID:   160710180 ChEBI URL:   ChEBI:66086 ChemSpider ID:   24626384 Ontomatica Chemical Accession Key (OnChAKey):   BQBLZAMUHGIEFL_JRVIZFGFSA_N_000_000000 PubChem Compound ID:   42640473