New Search

Item 32 of 1124 (back to results)
Previous previous next Next

schweinfurthin G
A stilbenoid that is the 3-deoxy derivative of vedelianin. Isolated from Macaranga alnifolia, it exhibits cytotoxic activity.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 schweinfurthin G [CHEBI:66437] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 schweinfurthin G [CHEBI:66437] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 stilbenoid [CHEBI:26776] (32) 
 schweinfurthin G [CHEBI:66437] (1)
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 stilbenoid [CHEBI:26776] (32) 
 schweinfurthin G [CHEBI:66437] (1)
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 stilbenoid [CHEBI:26776] (32) 
 schweinfurthin G [CHEBI:66437] (1)
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 schweinfurthin G [CHEBI:66437] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 stilbenoid [CHEBI:26776] (32) 
 schweinfurthin G [CHEBI:66437] (1)
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 schweinfurthin G [CHEBI:66437] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 benzenediols [CHEBI:33570] (188) 
 resorcinols [CHEBI:33572] (46) 
 schweinfurthin G [CHEBI:66437] (1)
ChEBI Compound Accession Identifier  [CHEBI:66437]
ChEBI Compound Description  A stilbenoid that is the 3-deoxy derivative of vedelianin. Isolated from Macaranga alnifolia, it exhibits cytotoxic activity.
ChEBI Compound Identification Number  66437
ChEBI InChI Value  InChI=1S/C29H36O5/c1-17(2)6-9-21-22(30)13-19(14-23(21)31)8-7-18-12-20-16-25-28(3,4)26(33)10-11-29(25,5)34-27(20)24(32)15-18/h6-8,12-15,25-26,30-33H,9-11,16H2,1-5H3/b8-7+/t25-,26-,29-/m1/s1
ChEBI InChIKey Value  CGJIPMVTBQUUQL-GEDZTWKOSA-N
ChEBI Compound Name  schweinfurthin G
ChEBI SMILES Value  [H][C@]12Cc3cc(cc(O)c3O[C@]1(C)CC[C@@H](O)C2(C)C)\C=C\c1cc(O)c(CC=C(C)C)c(O)c1
ChEBI Substance ID  160709774
ChEBI URL  ChEBI:66437
ChemSpider ID  17273828
Ontomatica Chemical Accession Key (OnChAKey)  CGJIPMVTBQUUQL_GEDZTWKOSA_N_000_000000
PubChem Compound ID  16116603