New Search

Item 32 of 85 (back to results)
Previous previous next Next

O-formylcefamandole
A cephalosporin compound having (R)-O-formylmandelamido and N-methylthiotetrazole side groups. It is used (as the sodium salt) as a progrug for cefamandole.

Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antibacterial agent [CHEBI:33282]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antibacterial agent [CHEBI:33282] (317) 
 O-formylcefamandole [CHEBI:53654] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 prodrug [CHEBI:50266] (88) 
 O-formylcefamandole [CHEBI:53654] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 cyclic amide [CHEBI:3990] (252) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 formate ester [CHEBI:52343] (4) 
 O-formylcefamandole [CHEBI:53654] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 formate ester [CHEBI:52343] (4) 
 O-formylcefamandole [CHEBI:53654] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 formate ester [CHEBI:52343] (4) 
 O-formylcefamandole [CHEBI:53654] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 formate ester [CHEBI:52343] (4) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 formate ester [CHEBI:52343] (4) 
 O-formylcefamandole [CHEBI:53654] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 O-formylcefamandole [CHEBI:53654] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 formate ester [CHEBI:52343] (4) 
 O-formylcefamandole [CHEBI:53654] (1)
ChEBI Compound Accession Identifier:   [CHEBI:53654]
ChEBI Compound Description:   A cephalosporin compound having (R)-O-formylmandelamido and N-methylthiotetrazole side groups. It is used (as the sodium salt) as a progrug for cefamandole.
ChEBI Compound Identification Number:   53654
ChEBI InChI Value:   InChI=1S/C19H18N6O6S2/c1-24-19(21-22-23-24)33-8-11-7-32-17-12(16(28)25(17)13(11)18(29)30)20-15(27)14(31-9-26)10-5-3-2-4-6-10/h2-6,9,12,14,17H,7-8H2,1H3,(H,20,27)(H,29,30)/t12-,14-,17-/m1/s1
ChEBI InChIKey Value:   RRJHESVQVSRQEX-SUYBPPKGSA-N
ChEBI Compound Name:   O-formylcefamandole
ChEBI SMILES Value:   [H]C(=O)O[C@@H](C(=O)N[C@@H]1C(=O)N2C(C(O)=O)=C(CSc3nnnn3C)CS[C@]12[H])c1ccccc1
ChEBI Substance ID:   87246572
ChEBI URL:   ChEBI:53654
ChemSpider ID:   4447585
Ontomatica Chemical Accession Key (OnChAKey):   RRJHESVQVSRQEX_SUYBPPKGSA_N_000_000000
PubChem Compound ID:   5284527