New Search

Item 33 of 53 (back to results)
Previous previous next Next

ciliatamide B
A lipopeptide that contains N-methylphenylalanine and lysine as the amino acid residues linked to a octanoyl moiety via an amide linkage (the R,R stereoisomer). It is isolated from the deep sea sponge Aaptos ciliata and exhibits antileishmanial and moderate cytotoxicity towards HeLa cells.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 ciliatamide B [CHEBI:65631] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antimicrobial drug [CHEBI:36043] (169) 
 antiprotozoal drug [CHEBI:35820] (168) 
 antileishmanial agent [CHEBI:70868] (22) 
 ciliatamide B [CHEBI:65631] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 ciliatamide B [CHEBI:65631] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 cyclic amide [CHEBI:3990] (252) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 ciliatamide B [CHEBI:65631] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 caprolactam [CHEBI:23000] (6) 
 ciliatamide B [CHEBI:65631] (1)
ChEBI Compound Accession Identifier  [CHEBI:65631]
ChEBI Compound Description  A lipopeptide that contains N-methylphenylalanine and lysine as the amino acid residues linked to a octanoyl moiety via an amide linkage (the R,R stereoisomer). It is isolated from the deep sea sponge Aaptos ciliata and exhibits antileishmanial and moderate cytotoxicity towards HeLa cells.
ChEBI Compound Identification Number  65631
ChEBI InChI Value  InChI=1S/C24H37N3O3/c1-3-4-5-6-10-16-22(28)27(2)21(18-19-13-8-7-9-14-19)24(30)26-20-15-11-12-17-25-23(20)29/h7-9,13-14,20-21H,3-6,10-12,15-18H2,1-2H3,(H,25,29)(H,26,30)/t20-,21-/m1/s1
ChEBI InChIKey Value  FNPKNWJUFWGJJV-NHCUHLMSSA-N
ChEBI Compound Name  ciliatamide B
ChEBI SMILES Value  CCCCCCCC(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@@H]1CCCCNC1=O
ChEBI Substance ID  160655772
ChEBI URL  ChEBI:65631
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  FNPKNWJUFWGJJV_NHCUHLMSSA_N_000_000000
PubChem Compound ID  25112530