Item 33 of 59 (back to results) previous next callophycol B A dibromophenol that is 2,4-dibromophenol substituted at position 6 by a decahydronaphthalen-1-ylmethyl group which in turn is substituted by a bromo, 4-bromo-3-chloro-4-methylpentyl group, two methyl groups and a methylidene group at positions 6, 5, 5, 8a and 2 respectively. A diterpenoid isolated from the Fijian red alga Callophycus serratus, it exhibits antibacterial, antimalarial and anticancer activities.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   callophycol B [CHEBI:65566] (1)  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   callophycol B [CHEBI:65566] (1)  antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antimalarial [CHEBI:38068] (89)   callophycol B [CHEBI:65566] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   callophycol B [CHEBI:65566] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   callophycol B [CHEBI:65566] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   callophycol B [CHEBI:65566] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   callophycol B [CHEBI:65566] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   callophycol B [CHEBI:65566] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   callophycol B [CHEBI:65566] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   callophycol B [CHEBI:65566] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   callophycol B [CHEBI:65566] (1)  bicyclic compound [CHEBI:33636] (1511)   carbobicyclic compound [CHEBI:36785] (199)   callophycol B [CHEBI:65566] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   callophycol B [CHEBI:65566] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   callophycol B [CHEBI:65566] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   bromophenol [CHEBI:33624] (3)   dibromophenol [CHEBI:33625] (3)   callophycol B [CHEBI:65566] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   callophycol B [CHEBI:65566] (1) ChEBI Compound Accession Identifier:   [CHEBI:65566] ChEBI Compound Description:   A dibromophenol that is 2,4-dibromophenol substituted at position 6 by a decahydronaphthalen-1-ylmethyl group which in turn is substituted by a bromo, 4-bromo-3-chloro-4-methylpentyl group, two methyl groups and a methylidene group at positions 6, 5, 5, 8a and 2 respectively. A diterpenoid isolated from the Fijian red alga Callophycus serratus, it exhibits antibacterial, antimalarial and anticancer activities. ChEBI Compound Identification Number:   65566 ChEBI InChI Value:   InChI=1S/C26H35Br4ClO/c1-15-6-7-20-25(4,18(15)13-16-12-17(27)14-19(28)23(16)32)10-8-21(29)26(20,5)11-9-22(31)24(2,3)30/h12,14,18,20-22,32H,1,6-11,13H2,2-5H3/t18-,20+,21-,22?,25+,26-/m1/s1 ChEBI InChIKey Value:   NFMVWIXBGOEENC-VJCWLMRASA-N ChEBI Compound Name:   callophycol B ChEBI SMILES Value:   [H][C@]12CCC(=C)[C@@H](Cc3cc(Br)cc(Br)c3O)[C@]1(C)CC[C@@H](Br)[C@]2(C)CCC(Cl)C(C)(C)Br ChEBI Substance ID:   160655755 ChEBI URL:   ChEBI:65566 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   NFMVWIXBGOEENC_VJCWLMRASA_N_000_000000 PubChem Compound ID:   23584430