| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
|
|
|
|
samaderine E [CHEBI:66161] (1) |
|
|
|
samaderine E [CHEBI:66161] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:66161] |
| ChEBI Compound Description: |
A quassinoid isolated from Quassia indica and Samadera indica and has been shown to exhibit antimalarial and cytotoxic activities. |
| ChEBI Compound Identification Number: |
66161 |
| ChEBI InChI Value: |
InChI=1S/C20H26O8/c1-8-4-10(21)15(24)17(2)9(8)5-11-19-7-27-18(3,16(25)13(23)14(17)19)20(19,26)6-12(22)28-11/h4,9,11,13-16,23-26H,5-7H2,1-3H3/t9-,11+,13+,14+,15+,16-,17-,18+,19+,20+/m0/s1 |
| ChEBI InChIKey Value: |
MGGPOESVKAWHRB-KZOVRTNRSA-N |
| ChEBI Compound Name: |
samaderine E |
| ChEBI SMILES Value: |
[H][C@@]12C[C@@]3([H])C(C)=CC(=O)[C@@H](O)[C@]3(C)[C@@]3([H])[C@@H](O)[C@H](O)[C@@]4(C)OC[C@@]13[C@@]4(O)CC(=O)O2 |
| ChEBI Substance ID: |
160709913 |
| ChEBI URL: |
ChEBI:66161 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
MGGPOESVKAWHRB_KZOVRTNRSA_N_000_000000 |
| PubChem Compound ID: |
10475714 |