Item 37 of 59 (back to results) previous next diuvaretin A member of the class of dihydrochalcones that is dihydrochalcone substituted by 2-hydroxybenzyl groups at positions 3 and 5, hydroxy groups at positions 2 and 4 and a methoxy group at position 6. Isolated from the roots of Uvaria acuminata and Uvaria chamae, it exhibits cytotoxicity towards human promyelocytic leukemia HL-60 cells.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   diuvaretin [CHEBI:65802] (1)  antimicrobial agent [CHEBI:33281] (927)   antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antimalarial [CHEBI:38068] (89)   diuvaretin [CHEBI:65802] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   diuvaretin [CHEBI:65802] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   diuvaretin [CHEBI:65802] (1)  flavonoids [CHEBI:72544] (433)   dihydrochalcones [CHEBI:71230] (13)   diuvaretin [CHEBI:65802] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   diuvaretin [CHEBI:65802] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   diuvaretin [CHEBI:65802] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1)  flavonoids [CHEBI:72544] (433)   dihydrochalcones [CHEBI:71230] (13)   diuvaretin [CHEBI:65802] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   diuvaretin [CHEBI:65802] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   diuvaretin [CHEBI:65802] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   diuvaretin [CHEBI:65802] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   benzenediols [CHEBI:33570] (188)   resorcinols [CHEBI:33572] (46)   diuvaretin [CHEBI:65802] (1) ChEBI Compound Accession Identifier:   [CHEBI:65802] ChEBI Compound Description:   A member of the class of dihydrochalcones that is dihydrochalcone substituted by 2-hydroxybenzyl groups at positions 3 and 5, hydroxy groups at positions 2 and 4 and a methoxy group at position 6. Isolated from the roots of Uvaria acuminata and Uvaria chamae, it exhibits cytotoxicity towards human promyelocytic leukemia HL-60 cells. ChEBI Compound Identification Number:   65802 ChEBI InChI Value:   InChI=1S/C30H28O6/c1-36-30-23(18-21-12-6-8-14-25(21)32)28(34)22(17-20-11-5-7-13-24(20)31)29(35)27(30)26(33)16-15-19-9-3-2-4-10-19/h2-14,31-32,34-35H,15-18H2,1H3 ChEBI InChIKey Value:   KDEMELRYKGOXDL-UHFFFAOYSA-N ChEBI Compound Name:   diuvaretin ChEBI SMILES Value:   COc1c(Cc2ccccc2O)c(O)c(Cc2ccccc2O)c(O)c1C(=O)CCc1ccccc1 ChEBI Substance ID:   160709526 ChEBI URL:   ChEBI:65802 ChemSpider ID:   2342170 Ontomatica Chemical Accession Key (OnChAKey):   KDEMELRYKGOXDL_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3085222