Item 38 of 140 (back to results) previous next dicerandrol B A biaryl that is 5,5',7,7',9,9',10a,10a'-octahydro-6H,6'H-2,2'-bixanthene substituted by acetyloxy groups at C-5 and C-5', (acetyloxy)methyl group at C-10a, hydroxy groups at C-1, C-1', C-8 and C-8', hydroxymethyl group at C-10a', methyl groups at C-6 and C-6' and oxo groups at C-9 and C-9' respectively. A dimeric tetrahydroxanthone derivative isolated from Phomopsis longicolla, it exhibits antibacterial and cytotoxic activities.

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] × 07. Part of Biological Source of Chemical: unspecified structure [PO:0000004] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   dicerandrol B [CHEBI:65765] (1)  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   dicerandrol B [CHEBI:65765] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   dicerandrol B [CHEBI:65765] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Fungi, Yeasts, Molds and Mildews (348)   Deuteromycotina (255)   Coelomycetes (30)   Phomopsis (5)   Phomopsis longicolla (3) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   dicerandrol B [CHEBI:65765] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   dicerandrol B [CHEBI:65765] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   dicerandrol B [CHEBI:65765] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   dicerandrol B [CHEBI:65765] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   dicerandrol B [CHEBI:65765] (1)  oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   dicerandrol B [CHEBI:65765] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   dicerandrol B [CHEBI:65765] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   dicerandrol B [CHEBI:65765] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  ring assembly [CHEBI:36820] (165)   biaryl [CHEBI:64459] (79)   dicerandrol B [CHEBI:65765] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   xanthones [CHEBI:51149] (37)   dicerandrol B [CHEBI:65765] (1)  carboxylic ester [CHEBI:33308] (1495)   acetate ester [CHEBI:47622] (184)   dicerandrol B [CHEBI:65765] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   primary alcohol [CHEBI:15734] (167)   dicerandrol B [CHEBI:65765] (1)  phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   dicerandrol B [CHEBI:65765] (1) ChEBI Compound Accession Identifier:   [CHEBI:65765] ChEBI Compound Description:   A biaryl that is 5,5',7,7',9,9',10a,10a'-octahydro-6H,6'H-2,2'-bixanthene substituted by acetyloxy groups at C-5 and C-5', (acetyloxy)methyl group at C-10a, hydroxy groups at C-1, C-1', C-8 and C-8', hydroxymethyl group at C-10a', methyl groups at C-6 and C-6' and oxo groups at C-9 and C-9' respectively. A dimeric tetrahydroxanthone derivative isolated from Phomopsis longicolla, it exhibits antibacterial and cytotoxic activities. ChEBI Compound Identification Number:   65765 ChEBI InChI Value:   InChI=1S/C36H36O15/c1-14-10-21(41)27-31(45)25-23(50-35(27,12-37)33(14)48-17(4)39)8-6-19(29(25)43)20-7-9-24-26(30(20)44)32(46)28-22(42)11-15(2)34(49-18(5)40)36(28,51-24)13-47-16(3)38/h6-9,14-15,33-34,37,41-44H,10-13H2,1-5H3/t14-,15-,33-,34-,35+,36+/m1/s1 ChEBI InChIKey Value:   WRLHYRADHSNDLJ-NKSNWBLISA-N ChEBI Compound Name:   dicerandrol B ChEBI SMILES Value:   C[C@@H]1CC(O)=C2C(=O)c3c(O[C@]2(CO)[C@@H]1OC(C)=O)ccc(c3O)-c1ccc2O[C@]3(COC(C)=O)[C@H](OC(C)=O)[C@H](C)CC(O)=C3C(=O)c2c1O ChEBI Substance ID:   160709466 ChEBI URL:   ChEBI:65765 ChemSpider ID:   10213917 Ontomatica Chemical Accession Key (OnChAKey):   WRLHYRADHSNDLJ_NKSNWBLISA_N_000_000000 PubChem Compound ID:   10055578