Item 38 of 10027 (back to results) previous next 2-methylthio-1,3-benzothiazole An organic sulfide that is the methyl thioether of 1,3-benzothiazole-2-thiol.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > pnictogen molecular entity [CHEBI:33302] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   agonist [CHEBI:48705] (68)   aryl hydrocarbon receptor agonist [CHEBI:72768] (1)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   sulfide [CHEBI:26822] (86)   organic sulfide [CHEBI:16385] (82)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur compound [CHEBI:33261] (1005)   organic sulfide [CHEBI:16385] (82)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organic sulfide [CHEBI:16385] (82)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organic sulfide [CHEBI:16385] (82)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   2-methylthio-1,3-benzothiazole [CHEBI:1217] (1) ChEBI Compound Accession Identifier:   [CHEBI:1217] ChEBI Compound Description:   An organic sulfide that is the methyl thioether of 1,3-benzothiazole-2-thiol. ChEBI Compound Identification Number:   1217 ChEBI InChI Value:   InChI=1S/C8H7NS2/c1-10-8-9-6-4-2-3-5-7(6)11-8/h2-5H,1H3 ChEBI InChIKey Value:   UTBVIMLZIRIFFR-UHFFFAOYSA-N ChEBI Compound Name:   2-methylthio-1,3-benzothiazole ChEBI SMILES Value:   CSc1nc2ccccc2s1 ChEBI Substance ID:   85240166 ChEBI URL:   ChEBI:1217 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   UTBVIMLZIRIFFR_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   11989