Item 40 of 50 (back to results) previous next brevianamide F A pyrrolopyrazine that is hexahydropyrrolo[1,2-a]pyrazine-1,4-dione bearing an indol-3-ylmethyl substituent at position 3 (the 3S,8aS-diastereomer, obtained by formal cyclocondensation of L-tryptophan and L-proline).

Current search: 04. Bioactive Capabilities of Specific Chemicals : Transferases [EC:2] × 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   brevianamide F [CHEBI:64530] (1) 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Transferases [EC:2] (1441)   Transferring alkyl or aryl groups, other than methyl groups [EC:2.5] (171)   Transferring Alkyl or Aryl Groups, Other than Methyl Groups [EC:2.5.1] (171)   Tryprostatin B synthase [EC:2.5.1.106] (4)   brevianamide F [CHEBI:64530] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   brevianamide F [CHEBI:64530] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1)  pyrrolopyrazine [CHEBI:48337] (9)   brevianamide F [CHEBI:64530] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   brevianamide F [CHEBI:64530] (1) ChEBI Compound Accession Identifier:   [CHEBI:64530] ChEBI Compound Description:   A pyrrolopyrazine that is hexahydropyrrolo[1,2-a]pyrazine-1,4-dione bearing an indol-3-ylmethyl substituent at position 3 (the 3S,8aS-diastereomer, obtained by formal cyclocondensation of L-tryptophan and L-proline). ChEBI Compound Identification Number:   64530 ChEBI InChI Value:   InChI=1S/C16H17N3O2/c20-15-14-6-3-7-19(14)16(21)13(18-15)8-10-9-17-12-5-2-1-4-11(10)12/h1-2,4-5,9,13-14,17H,3,6-8H2,(H,18,20)/t13-,14-/m0/s1 ChEBI InChIKey Value:   RYFZBPVMVYTEKZ-KBPBESRZSA-N ChEBI Compound Name:   brevianamide F ChEBI SMILES Value:   [H][C@@]12CCCN1C(=O)[C@H](Cc1c[nH]c3ccccc13)NC2=O ChEBI Substance ID:   136349076 ChEBI URL:   ChEBI:64530 ChemSpider ID:   157941 Ontomatica Chemical Accession Key (OnChAKey):   RYFZBPVMVYTEKZ_KBPBESRZSA_N_000_000000 PubChem Compound ID:   181567