Item 40 of 125 (back to results) previous next brasiliquinone B A carbopolycyclic compound that is 3,4-dihydrotetraphene-1,7,12(2H)-trione substituted by hydroxy groups at positions 6 and 8 and an ethyl group at position 3 (the S stereoisomer). It is isolated from the culture broth of Nocardia brasiliensis and exhibits antibacterial activity against Gram-positive bacteria. It is also active against the multiple drug-resistant P388/ADR tumour cells.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > oxygen molecular entity [CHEBI:25806] > organooxygen compound [CHEBI:36963] > carbonyl compound [CHEBI:36586] × 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   brasiliquinone B [CHEBI:65517] (1)  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   brasiliquinone B [CHEBI:65517] (1)  antibacterial agent [CHEBI:33282] (317)   brasiliquinone B [CHEBI:65517] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   brasiliquinone B [CHEBI:65517] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Nocardiaceae (9)   Nocardia (9)   Nocardia brasiliensis (6) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   brasiliquinone B [CHEBI:65517] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   brasiliquinone B [CHEBI:65517] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   brasiliquinone B [CHEBI:65517] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1)  quinone [CHEBI:36141] (209)   brasiliquinone B [CHEBI:65517] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   brasiliquinone B [CHEBI:65517] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   brasiliquinone B [CHEBI:65517] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   brasiliquinone B [CHEBI:65517] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   brasiliquinone B [CHEBI:65517] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   brasiliquinone B [CHEBI:65517] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   brasiliquinone B [CHEBI:65517] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   brasiliquinone B [CHEBI:65517] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   brasiliquinone B [CHEBI:65517] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   brasiliquinone B [CHEBI:65517] (1) ChEBI Compound Accession Identifier:   [CHEBI:65517] ChEBI Compound Description:   A carbopolycyclic compound that is 3,4-dihydrotetraphene-1,7,12(2H)-trione substituted by hydroxy groups at positions 6 and 8 and an ethyl group at position 3 (the S stereoisomer). It is isolated from the culture broth of Nocardia brasiliensis and exhibits antibacterial activity against Gram-positive bacteria. It is also active against the multiple drug-resistant P388/ADR tumour cells. ChEBI Compound Identification Number:   65517 ChEBI InChI Value:   InChI=1S/C20H16O5/c1-2-9-6-10-8-14(23)17-18(15(10)13(22)7-9)19(24)11-4-3-5-12(21)16(11)20(17)25/h3-5,8-9,21,23H,2,6-7H2,1H3/t9-/m0/s1 ChEBI InChIKey Value:   YXEPHAVILJDRHK-VIFPVBQESA-N ChEBI Compound Name:   brasiliquinone B ChEBI SMILES Value:   CC[C@@H]1CC(=O)c2c(C1)cc(O)c1C(=O)c3c(O)cccc3C(=O)c21 ChEBI Substance ID:   160644956 ChEBI URL:   ChEBI:65517 ChemSpider ID:   8059861 Ontomatica Chemical Accession Key (OnChAKey):   YXEPHAVILJDRHK_VIFPVBQESA_N_000_000000 PubChem Compound ID:   9884187