New Search

Item 40 of 202 (back to results)
Previous previous next Next

N-isopropyl-2-chloroacetanilide
An anilide that consists of 2-chloroacetanilide bearing an N-isopropyl substituent.


Current search:

08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675]
×
05. Industrial Uses: pesticide [CHEBI:25944]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pesticide [CHEBI:25944] (211) 
 herbicide [CHEBI:24527] (48) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 N-isopropyl-2-chloroacetanilide [CHEBI:19503] (1)
ChEBI Compound Accession Identifier  [CHEBI:19503]
ChEBI Compound Description  An anilide that consists of 2-chloroacetanilide bearing an N-isopropyl substituent.
ChEBI Compound Identification Number  19503
ChEBI InChI Value  InChI=1S/C11H14ClNO/c1-9(2)13(11(14)8-12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
ChEBI InChIKey Value  MFOUDYKPLGXPGO-UHFFFAOYSA-N
ChEBI Compound Name  N-isopropyl-2-chloroacetanilide
ChEBI SMILES Value  CC(C)N(C(=O)CCl)c1ccccc1
ChEBI Substance ID  126522673
ChEBI URL  ChEBI:19503
ChemSpider ID  4762
Ontomatica Chemical Accession Key (OnChAKey)  MFOUDYKPLGXPGO_UHFFFAOYSA_N_000_000000
PubChem Compound ID  4931