Item 395 of 1872 (back to results) previous next pyranojacareubin An organic heteropentacyclic compound that is 2H,6H,10H-dipyrano[3,2-b:2',3'-i]xanthene substituted by hydroxy groups at positions 5 and 12, geminal methyl groups at positions 2 and 10 and an oxo group at position 6. Isolated from Calophyllum blancoi it exhibits antiviral activity.

Current search: 06. Name of Biological Source of Chemical: Plantae > Magnoliophyta × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   pyranojacareubin [CHEBI:66302] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   pyranojacareubin [CHEBI:66302] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Malpighiales (287)   Calophyllaceae (28)   Calophyllum (11)   Calophyllum blancoi (2)  Family Clusiaceae (67)   Subfamily Clusioideae (33)   Tribe Garcinieae (32)   Garcinia (32)   Garcinia densivenia (1) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   portion of plant tissue [PO:0009007] (272)   epidermis [PO:0005679] (134)   shoot epidermis [PO:0006035] (134)   shoot axis epidermis [PO:0000112] (134)   stem epidermis [PO:0025178] (134)  multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   root [PO:0009005] (486) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranojacareubin [CHEBI:66302] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranojacareubin [CHEBI:66302] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranojacareubin [CHEBI:66302] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranojacareubin [CHEBI:66302] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranojacareubin [CHEBI:66302] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranojacareubin [CHEBI:66302] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranojacareubin [CHEBI:66302] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranojacareubin [CHEBI:66302] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranojacareubin [CHEBI:66302] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranojacareubin [CHEBI:66302] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   pyranojacareubin [CHEBI:66302] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranojacareubin [CHEBI:66302] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   pyranojacareubin [CHEBI:66302] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   pyranojacareubin [CHEBI:66302] (1) ChEBI Compound Accession Identifier:   [CHEBI:66302] ChEBI Compound Description:   An organic heteropentacyclic compound that is 2H,6H,10H-dipyrano[3,2-b:2',3'-i]xanthene substituted by hydroxy groups at positions 5 and 12, geminal methyl groups at positions 2 and 10 and an oxo group at position 6. Isolated from Calophyllum blancoi it exhibits antiviral activity. ChEBI Compound Identification Number:   66302 ChEBI InChI Value:   InChI=1S/C23H20O6/c1-22(2)8-6-12-14(28-22)10-15-16(17(12)24)18(25)13-9-11-5-7-23(3,4)29-20(11)19(26)21(13)27-15/h5-10,24,26H,1-4H3 ChEBI InChIKey Value:   ZMJXZBDITYZMTK-UHFFFAOYSA-N ChEBI Compound Name:   pyranojacareubin ChEBI SMILES Value:   CC1(C)Oc2cc3oc4c(O)c5OC(C)(C)C=Cc5cc4c(=O)c3c(O)c2C=C1 ChEBI Substance ID:   160709699 ChEBI URL:   ChEBI:66302 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   ZMJXZBDITYZMTK_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   15307925