New Search

Item 44 of 72 (back to results)
Previous previous next Next

glycyrrhizol B
An organic heteropentacyclic compound that is 2H-pyrano[3',4',5'',6'']-pterocarpene substituted by a hydroxy group at position 7, a methoxy group at position 5 and geminal methyl groups at position 2''. Isolated from the roots of Glycyrrhiza uralensis, it exhibits antibacterial activity.


Current search:

07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496] > plant organ [PO:0009008]
×
03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 glycyrrhizol B [CHEBI:65977] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antibacterial agent [CHEBI:33282] (317) 
 glycyrrhizol B [CHEBI:65977] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Fabales (151) 
 Fabaceae (151) 
 Faboideae (97) 
 Glycyrrhiza (26) 
 Glycyrrhiza uralensis (24)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 multi-tissue plant structure [PO:0025496] (1114) 
 plant organ [PO:0009008] (970) 
 plant axis [PO:0025004] (691) 
 root [PO:0009005] (486)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 glycyrrhizol B [CHEBI:65977] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 glycyrrhizol B [CHEBI:65977] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 glycyrrhizol B [CHEBI:65977] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 glycyrrhizol B [CHEBI:65977] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 glycyrrhizol B [CHEBI:65977] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 glycyrrhizol B [CHEBI:65977] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 glycyrrhizol B [CHEBI:65977] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 glycyrrhizol B [CHEBI:65977] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 glycyrrhizol B [CHEBI:65977] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 glycyrrhizol B [CHEBI:65977] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 glycyrrhizol B [CHEBI:65977] (1)
ChEBI Compound Accession Identifier  [CHEBI:65977]
ChEBI Compound Description  An organic heteropentacyclic compound that is 2H-pyrano[3',4',5'',6'']-pterocarpene substituted by a hydroxy group at position 7, a methoxy group at position 5 and geminal methyl groups at position 2''. Isolated from the roots of Glycyrrhiza uralensis, it exhibits antibacterial activity.
ChEBI Compound Identification Number  65977
ChEBI InChI Value  InChI=1S/C21H18O5/c1-21(2)7-6-13-15(26-21)5-4-12-14-10-24-17-9-11(22)8-16(23-3)18(17)20(14)25-19(12)13/h4-9,22H,10H2,1-3H3
ChEBI InChIKey Value  BKLGAGSBCOUJGV-UHFFFAOYSA-N
ChEBI Compound Name  glycyrrhizol B
ChEBI SMILES Value  COc1cc(O)cc2OCc3c(oc4c5C=CC(C)(C)Oc5ccc34)-c12
ChEBI Substance ID  160709832
ChEBI URL  ChEBI:65977
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  BKLGAGSBCOUJGV_UHFFFAOYSA_N_000_000000
PubChem Compound ID  11609971