Item 44 of 62 (back to results) previous next jerantinine B An indole alkaloid that is tabersonine substituted by a hydroxy group at potition 10, a methoxy group at position 11 and an epoxy group across positions 14 and 15. Isolated from Tabernaemontana corymbosa, it exhibits cytotoxicity against human KB cells.

Current search: 07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496] > plant organ [PO:0009008] > phyllome [PO:0006001] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   jerantinine B [CHEBI:66120] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   jerantinine B [CHEBI:66120] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Gentianales (112)   Apocynaceae (39)   Tabernaemontana (6)   Tabernaemontana corymbosa (6) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   phyllome [PO:0006001] (351)   leaf [PO:0025034] (351) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  indole alkaloid [CHEBI:38958] (144)   jerantinine B [CHEBI:66120] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   jerantinine B [CHEBI:66120] (1)  cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   jerantinine B [CHEBI:66120] (1)  cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  indole alkaloid [CHEBI:38958] (144)   jerantinine B [CHEBI:66120] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   jerantinine B [CHEBI:66120] (1)  cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1)  aromatic ether [CHEBI:35618] (353)   jerantinine B [CHEBI:66120] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1)  aromatic ether [CHEBI:35618] (353)   jerantinine B [CHEBI:66120] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1)  aromatic ether [CHEBI:35618] (353)   jerantinine B [CHEBI:66120] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   jerantinine B [CHEBI:66120] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1)  aromatic ether [CHEBI:35618] (353)   jerantinine B [CHEBI:66120] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   alkaloid ester [CHEBI:38481] (18)   jerantinine B [CHEBI:66120] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   jerantinine B [CHEBI:66120] (1) ChEBI Compound Accession Identifier:   [CHEBI:66120] ChEBI Compound Description:   An indole alkaloid that is tabersonine substituted by a hydroxy group at potition 10, a methoxy group at position 11 and an epoxy group across positions 14 and 15. Isolated from Tabernaemontana corymbosa, it exhibits cytotoxicity against human KB cells. ChEBI Compound Identification Number:   66120 ChEBI InChI Value:   InChI=1S/C22H26N2O5/c1-4-21-9-11(19(26)28-3)17-22(5-6-24(20(21)22)10-16-18(21)29-16)12-7-14(25)15(27-2)8-13(12)23-17/h7-8,16,18,20,23,25H,4-6,9-10H2,1-3H3/t16-,18-,20-,21+,22-/m0/s1 ChEBI InChIKey Value:   BECBFSXLBJGONE-DIMUUIPOSA-N ChEBI Compound Name:   jerantinine B ChEBI SMILES Value:   [H][C@]12CN3CC[C@@]45C(Nc6cc(OC)c(O)cc46)=C(C[C@](CC)([C@@]1([H])O2)[C@]35[H])C(=O)OC ChEBI Substance ID:   160710188 ChEBI URL:   ChEBI:66120 ChemSpider ID:   24687211 Ontomatica Chemical Accession Key (OnChAKey):   BECBFSXLBJGONE_DIMUUIPOSA_N_000_000000 PubChem Compound ID:   25058083