New Search

Item 484 of 1441 (back to results)
Previous previous next Next

5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether
A phenol compound having a methoxy substituent at the 3-position and a 8-cis,11-cis-pentadeca-8,11,14-trien-1-yl substituent at the 5-position.


Current search:

04. Bioactive Capabilities of Specific Chemicals : Transferases [EC:2]
×

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Transferases [EC:2] (1441) 
 Transferring one-carbon groups [EC:2.1] (318) 
 Methyltransferases [EC:2.1.1] (279) 
 5-pentadecatrienyl resorcinol O-methyltransferase [EC:2.1.1.n7] (5) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether [CHEBI:52681] (1)
ChEBI Compound Accession Identifier  [CHEBI:52681]
ChEBI Compound Description  A phenol compound having a methoxy substituent at the 3-position and a 8-cis,11-cis-pentadeca-8,11,14-trien-1-yl substituent at the 5-position.
ChEBI Compound Identification Number  52681
ChEBI InChI Value  InChI=1S/C22H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17-21(23)19-22(18-20)24-2/h3,5-6,8-9,17-19,23H,1,4,7,10-16H2,2H3/b6-5-,9-8-
ChEBI InChIKey Value  GKGSHNPKQBMHTD-AFJQJTPPSA-N
ChEBI Compound Name  5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether
ChEBI SMILES Value  COc1cc(O)cc(CCCCCCC\\C=C/C\\C=C/CC=C)c1
ChEBI Substance ID  85096739
ChEBI URL  ChEBI:52681
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  GKGSHNPKQBMHTD_AFJQJTPPSA_N_000_000000
PubChem Compound ID  25244188