Item 50 of 130 (back to results) previous next psilocin "A hallucinogenic alkaloid isolated in trace amounts from Psilocybe mushrooms (also known as Teonanacatl or ""magic mushrooms"")."

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > psychotropic drug [CHEBI:35471] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   hallucinogen [CHEBI:35499] (10)   psilocin [CHEBI:8613] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   indole alkaloid [CHEBI:38958] (144)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   indole alkaloid [CHEBI:38958] (144)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   tryptamine alkaloid [CHEBI:48274] (6)   psilocin [CHEBI:8613] (1) ChEBI Compound Accession Identifier:   [CHEBI:8613] ChEBI Compound Description:   "A hallucinogenic alkaloid isolated in trace amounts from Psilocybe mushrooms (also known as Teonanacatl or ""magic mushrooms"")." ChEBI Compound Identification Number:   8613 ChEBI InChI Value:   InChI=1S/C12H16N2O/c1-14(2)7-6-9-8-13-10-4-3-5-11(15)12(9)10/h3-5,8,13,15H,6-7H2,1-2H3 ChEBI InChIKey Value:   SPCIYGNTAMCTRO-UHFFFAOYSA-N ChEBI Compound Name:   psilocin ChEBI SMILES Value:   CN(C)CCc1c[nH]c2cccc(O)c12 ChEBI Substance ID:   46530539 ChEBI URL:   ChEBI:8613 ChemSpider ID:   4807 Ontomatica Chemical Accession Key (OnChAKey):   SPCIYGNTAMCTRO_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   4980